|
|
| | CHLOROSUCCINIC ACID Basic information | | Uses |
| Product Name: | CHLOROSUCCINIC ACID | | Synonyms: | 2-chlorobutanedioic acid;Chlorosuccinic acid 96%;2-chlorosuccinic acid;DL-A-CHLOROSUCCINIC ACID;DL-ALPHA-CHLOROSUCCINIC ACID;CHLOROSUCCINIC ACID;DL-a-Chlorosuccinic acid 96%;Butanedioic acid, 2-chloro- | | CAS: | 16045-92-4 | | MF: | C4H5ClO4 | | MW: | 152.53 | | EINECS: | 240-188-3 | | Product Categories: | | | Mol File: | 16045-92-4.mol |  |
| | CHLOROSUCCINIC ACID Chemical Properties |
| Melting point | 150-153 °C(lit.) | | Boiling point | 210.59°C (rough estimate) | | density | 1.5077 (rough estimate) | | refractive index | 1.4100 (estimate) | | pka | 2.71±0.23(Predicted) | | Water Solubility | 180g/L(20 ºC) | | BRN | 1723551 | | InChI | InChI=1S/C4H5ClO4/c5-2(4(8)9)1-3(6)7/h2H,1H2,(H,6,7)(H,8,9) | | InChIKey | QEGKXSHUKXMDRW-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(Cl)CC(O)=O |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | CHLOROSUCCINIC ACID Usage And Synthesis |
| Uses | Chlorosilicate is a chemical intermediate that can be used as a precursor for the synthesis of agrochemicals and other organic compounds. It can also be used as a chemical reagent in nucleophilic substitution reactions, in which the chlorine atom is replaced by a nucleophile, resulting in the formation of new carbon-nitrogen or carbon-oxygen bonds. | | Definition | ChEBI: A C4-dicarboxylic acid that is succinic acid substituted at position 2 by a chloro group. |
| | CHLOROSUCCINIC ACID Preparation Products And Raw materials |
|