|
|
| | 4-Methylmorpholine N-oxide monohydrate Basic information |
| Product Name: | 4-Methylmorpholine N-oxide monohydrate | | Synonyms: | N-Methylmorpholin-N-oxid;4-METHYLMORPHOLINE-4-OXIDE MONOHYDRATE 97+%;4-METHYLMORPHOLINE N-OXIDE MONOHYDRATE, 98+%;N-Methylmorpholine N-oxide monohydrate~NMMO;N-Methylmorpholine N-oxide monohydrate98% +;4-Methylmorpholine N-oxide monohydrate,99%;4-Methylmorpholine N-oxide monohydrate,97%;4-MethylMorpholine N-oxide Monohydrate >=95.0% (N) | | CAS: | 70187-32-5 | | MF: | C5H11NO2 | | MW: | 117.15 | | EINECS: | 676-991-4 | | Product Categories: | | | Mol File: | 70187-32-5.mol |  |
| | 4-Methylmorpholine N-oxide monohydrate Chemical Properties |
| Melting point | 71-75 °C | | storage temp. | Store below +30°C. | | form | Powder | | color | White to light beige | | Water Solubility | Soluble in water. | | Sensitive | Hygroscopic | | BRN | 5449441 | | InChI | InChI=1S/C5H11NO2/c1-6(7)2-4-8-5-3-6/h2-5H2,1H3 | | InChIKey | LFTLOKWAGJYHHR-UHFFFAOYSA-N | | SMILES | [N+]1([O-])(C)CCOCC1 | | CAS DataBase Reference | 70187-32-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 1 | | TSCA | Yes | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Repr. 2 |
| | 4-Methylmorpholine N-oxide monohydrate Usage And Synthesis |
| Chemical Properties | White to beige crystalline powder | | Uses | 4-Methylmorpholine N-oxide monohydrate is used as a solvent to prepare cellulose fibers. It is an oxidant and involved in the catalytic OsO4 oxidation of olefins to cis-1,2-diols. It is also involved in ruthenium catalyzed oxidation of alcohols to aldehydes and ketones. |
| | 4-Methylmorpholine N-oxide monohydrate Preparation Products And Raw materials |
|