1,1-DIPHENYL-2-PICRYLHYDRAZINE manufacturers
|
| | 1,1-DIPHENYL-2-PICRYLHYDRAZINE Basic information |
| Product Name: | 1,1-DIPHENYL-2-PICRYLHYDRAZINE | | Synonyms: | 1,1-diphenyl-2-(2,4,6-trinitrophenyl)-hydrazin;alpha,alpha-Diphenyl-beta-picryl hydrazide;alpha,alpha-Diphenyl-beta-picrylhydrazine;Diphenylpicrylhydrazine;Hydrazine, 1,1-diphenyl-2-picryl-;N,N-diphenyl-N'-picrylhydrazine;1,1-DIPHENYL-2-PICRYLHYDRAZINE 98+%;1-(2,4,6-Trinitrophenyl)-2,2-diphenylhydrazine | | CAS: | 1707-75-1 | | MF: | C18H13N5O6 | | MW: | 395.33 | | EINECS: | 216-953-2 | | Product Categories: | Building Blocks;Chemical Synthesis;Aromatic Hydrazides, Hydrazines, Hydrazones and Oximes;Hydrazines;Nitrogen Compounds;Organic Building Blocks;Nitrogen Compounds;Organic Building Blocks | | Mol File: | 1707-75-1.mol |  |
| | 1,1-DIPHENYL-2-PICRYLHYDRAZINE Chemical Properties |
| Melting point | ~174 °C (dec.)(lit.) | | Boiling point | 530.2±60.0 °C(Predicted) | | density | 1.539±0.06 g/cm3(Predicted) | | solubility | soluble in Chloroform | | form | powder to crystal | | pka | -0.84±0.50(Predicted) | | color | Orange to Brown to Dark red | | BRN | 770319 | | InChI | InChI=1S/C18H13N5O6/c24-21(25)15-11-16(22(26)27)18(17(12-15)23(28)29)19-20(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12,19H | | InChIKey | WCBPJVKVIMMEQC-UHFFFAOYSA-N | | SMILES | N(C1=CC=CC=C1)(C1=CC=CC=C1)NC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O | | CAS DataBase Reference | 1707-75-1(CAS DataBase Reference) | | EPA Substance Registry System | Hydrazine, 1,1-diphenyl-2-(2,4,6-trinitrophenyl)- (1707-75-1) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36/37 | | RIDADR | 1325 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 4.1 | | PackingGroup | III | | HS Code | 29280000 | | Storage Class | 4.1A - Other explosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Resp. Sens. 1 Self-react. C Skin Irrit. 2 Skin Sens. 1 |
| | 1,1-DIPHENYL-2-PICRYLHYDRAZINE Usage And Synthesis |
| Uses | 1,1-Diphenyl-2-picrylhydrazine has been known to show antioxidant and anticancer properties. |
| | 1,1-DIPHENYL-2-PICRYLHYDRAZINE Preparation Products And Raw materials |
|