|
|
| | Z-NLE-OH Basic information |
| Product Name: | Z-NLE-OH | | Synonyms: | (2S)-2-[[(Benzyloxy)carbonyl]amino]hexanoic acid;N-[(Phenylmethoxy)carbonyl]-L-norleucine;Z-Nle-OH ,98%;Z-L-Nle-OH (oil);Z-L-norleucine≥ 98% (HPLC);BENZYLOXYCARBONYL-L-NORLEUCINE;Cbz-L-Norleucine;N-Benzyloxycarbonyl-L-norleucine~Z-Nle-OH | | CAS: | 39608-30-5 | | MF: | C14H19NO4 | | MW: | 265.3 | | EINECS: | | | Product Categories: | Amino Acid Derivatives | | Mol File: | 39608-30-5.mol |  |
| | Z-NLE-OH Chemical Properties |
| Melting point | 56-58°C | | storage temp. | Sealed in dry,2-8°C | | form | powder | | color | white | | BRN | 3210973 | | Major Application | peptide synthesis | | InChI | 1S/C14H19NO4/c1-2-3-9-12(13(16)17)15-14(18)19-10-11-7-5-4-6-8-11/h4-8,12H,2-3,9-10H2,1H3,(H,15,18)(H,16,17)/t12-/m0/s1 | | InChIKey | NMYWMOZOCYAHNC-LBPRGKRZSA-N | | SMILES | CCCC[C@H](NC(=O)OCc1ccccc1)C(O)=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids |
| | Z-NLE-OH Usage And Synthesis |
| Chemical Properties | White powder | | Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | Z-NLE-OH Preparation Products And Raw materials |
|