- 6-Chloro-2-hexanone
-
- $1.50
-
2026-05-15
- CAS:10226-30-9
- Min. Order: 1g
- Purity: 99.0% Min
- Supply Ability: 100 Tons
- 6-Chloro-2-hexanone
-
- $50.00
-
2025-06-20
- CAS:10226-30-9
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 100000
|
| | 6-Chloro-2-hexanone Basic information |
| | 6-Chloro-2-hexanone Chemical Properties |
| Boiling point | 85.5-86.5 °C/16 mmHg (lit.) | | density | 1.02 g/mL at 25 °C (lit.) | | vapor pressure | 1.29-1.607hPa at 25℃ | | refractive index | n20/D 1.4435(lit.) | | Fp | 195 °F | | storage temp. | Freezer | | form | Liquid | | Specific Gravity | 1.03 | | color | Clear yellow to brown | | Water Solubility | Insoluble in water, soluble in chloroform (chloroform, carbon), n-heptane, ethanol, butanol, etc. | | InChI | InChI=1S/C6H11ClO/c1-6(8)4-2-3-5-7/h2-5H2,1H3 | | InChIKey | CMDIDTNMHQUVPE-UHFFFAOYSA-N | | SMILES | CC(=O)CCCCCl | | LogP | 1.43-1.492 at 20-25℃ | | CAS DataBase Reference | 10226-30-9(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 37/39-26-36 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | HS Code | 29141990 | | Storage Class | 10 - Combustible liquids |
| | 6-Chloro-2-hexanone Usage And Synthesis |
| Chemical Properties | clear yellow to brown liquid | | Uses | 6-Chloro-2-hexanone in the synthesis of the keto analogs began with 6-chloro-2-hexanone. Substituted 7-(oxoalkyl)theophyllines were synthesized by alkylation of the respective theophyllines with 6-chloro-2-hexanone. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 21, p. 140, 1956 DOI: 10.1021/jo01107a033 | | Flammability and Explosibility | Non flammable |
| | 6-Chloro-2-hexanone Preparation Products And Raw materials |
|