- Loureirin B
-
- $48.00
-
2026-07-27
- CAS:119425-90-0
- Purity: 99.83%
- Supply Ability: 10g
- Loureirin B
-
-
2023-02-24
- CAS:119425-90-0
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | LOUREIRIN B Basic information |
| | LOUREIRIN B Chemical Properties |
| Boiling point | 509.9±50.0 °C(Predicted) | | density | 1.177±0.06 g/cm3(Predicted) | | solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; DMSO:PBS (pH 7.2) (1:2): 0.33 mg/ml | | pka | 8.06±0.15(Predicted) | | form | powder | | color | White | | InChI | 1S/C18H20O5/c1-21-14-10-17(22-2)15(18(11-14)23-3)8-9-16(20)12-4-6-13(19)7-5-12/h4-7,10-11,19H,8-9H2,1-3H3 | | InChIKey | ZPFRAPVRYLGYEC-UHFFFAOYSA-N | | SMILES | O(C)c1c(c(cc(c1)OC)OC)CCC(=O)c2ccc(cc2)O |
| Safety Statements | 24/25 | | WGK Germany | WGK 3 | | HS Code | 29145090 | | Storage Class | 11 - Combustible Solids |
| | LOUREIRIN B Usage And Synthesis |
| Chemical Properties | White powder, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from the resin of the Dracaena frondosa tree. | | Uses | Loureirin B is a component of traditional Chinese medicine which helps combat neurodegenerative diseases. Extracted from the red resin of Dracaena cochinchinensis S.C Chen, known as Dragon’s Blood. | | Synthesis | After benzyl protection, 4-hydroxyacetophenone undergoes condensation with 2,4,6-trimethoxybenzaldehyde under strong base catalysis (such as sodium hydroxide) to generate the corresponding chalcone intermediate. Finally, hydrogenation is carried out at atmospheric pressure using palladium on carbon (Pd/C) as a catalyst to remove the benzyl protecting group and simultaneously reduce the chalcone double bond, yielding Loureirin B. | | in vivo | Loureirin B significantly improves the arrangement and deposition of collagen fibres, decreases protein levels of ColI, ColIII and α-SMA and suppresses myofibroblast differentiation and scar proliferative activity, in a rabbit ear scar model. Loureirin B effectively inhibits TGF-β1-induced upregulation of ColI, ColIII and α-SMA levels, myofibroblast differentiation and the activation of Smad2 and Smad3, in NS fibroblasts[3]. | | IC 50 | PAI-1: 26.1 μM (IC50); KATP; ERK; JNK |
| | LOUREIRIN B Preparation Products And Raw materials |
|