L-(-)-MANNOSE manufacturers
- D-(+)-Mannose
-
- $9.80
-
2020-02-07
- CAS:10030-80-5
- Min. Order: 1KG
- Purity: >98%HPLC
- Supply Ability: 20 tons
|
| | L-(-)-MANNOSE Basic information |
| Product Name: | L-(-)-MANNOSE | | Synonyms: | MANNOSE, L-(-)-(RG);L-Mannose ,98%;(2R,3R,4S,5S)-2,3,4,5,6-pentahydroxyhexanal;aldehydo-L-mannose;L-MANNOPYRANOSE;L-(-)-MANNOSE;L-MANNOSE, 98%, MIXTURE OF ANOMERS;L -(-)-MANNOSE 99+% | | CAS: | 10030-80-5 | | MF: | C6H12O6 | | MW: | 180.16 | | EINECS: | 233-080-2 | | Product Categories: | carbohydrate;13C & 2H Sugars;Basic Sugars (Mono & Oligosaccharides);Biochemistry;Sugars;aldehydes;Carbohydrates & Derivatives;Glycon Biochem | | Mol File: | 10030-80-5.mol |  |
| | L-(-)-MANNOSE Chemical Properties |
| Melting point | 129-131 °C(lit.) | | Boiling point | 232.96°C (rough estimate) | | density | 1.2805 (rough estimate) | | refractive index | -14 ° (C=4, H2O) | | storage temp. | Inert atmosphere,2-8°C | | solubility | H2O: 0.1 g/mL, clear, colorless | | form | Powder | | pka | 12.45±0.20(Predicted) | | color | White to off-white | | Water Solubility | Soluble in Water (100 mg/mL). | | BRN | 1724628 | | InChI | 1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5+,6/m0/s1 | | InChIKey | WQZGKKKJIJFFOK-JFNONXLTSA-N | | SMILES | OC[C@@H]1OC(O)[C@H](O)[C@H](O)[C@H]1O | | LogP | -3.290 (est) | | CAS DataBase Reference | 10030-80-5(CAS DataBase Reference) | | EPA Substance Registry System | L-Mannose (10030-80-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-36-26 | | WGK Germany | 3 | | F | 3-10 | | TSCA | TSCA listed | | HS Code | 29400000 | | Storage Class | 11 - Combustible Solids |
| | L-(-)-MANNOSE Usage And Synthesis |
| Chemical Properties | White Powder | | Uses | L-mannose is a compound useful in organic synthesis. | | Definition | ChEBI: The L-enantiomer of aldehydo-mannose. |
| | L-(-)-MANNOSE Preparation Products And Raw materials |
|