|
|
| | 4-METHOXY-2,3,6-TRIMETHYL-BENZALDEHYDE Basic information |
| Product Name: | 4-METHOXY-2,3,6-TRIMETHYL-BENZALDEHYDE | | Synonyms: | 4-METHOXY-2,3,6-TRIMETHYL-BENZALDEHYDE;CHEMBRDG-BB 5229799;TIMTEC-BB SBB010628;2,3,6-trimethyl-p-anisaldehyde;2,3,6-Trimethyl-p-anisaldehyd;4-metoxy-2,3,6-trimetylbenzaldehyde;4-methoxy-2,3,6-trimethylbenzaldehyde(SALTDATA: FREE);Benzaldehyde, 4-methoxy-2,3,6-trimethyl- | | CAS: | 54344-92-2 | | MF: | C11H14O2 | | MW: | 178.23 | | EINECS: | 259-117-2 | | Product Categories: | Aromatics;Aromatic Aldehydes & Derivatives (substituted) | | Mol File: | 54344-92-2.mol |  |
| | 4-METHOXY-2,3,6-TRIMETHYL-BENZALDEHYDE Chemical Properties |
| Melting point | 63.0 to 68.0 °C | | Boiling point | 301.2±37.0 °C(Predicted) | | density | 1.024±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | Chloroform, Dichloromethane, Ethyl Acetate, Tetrahydrofuran | | form | Solid | | color | White | | InChI | InChI=1S/C11H14O2/c1-7-5-11(13-4)9(3)8(2)10(7)6-12/h5-6H,1-4H3 | | InChIKey | BTOFIDLWQJCUJG-UHFFFAOYSA-N | | SMILES | C(=O)C1=C(C)C=C(OC)C(C)=C1C |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 2 | | HS Code | 2912.49.2600 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 4-METHOXY-2,3,6-TRIMETHYL-BENZALDEHYDE Usage And Synthesis |
| Chemical Properties | White Crystaline Solid | | Uses | 4-Methoxy-2,3,6-trimethylbenzaldehyde (cas# 54344-92-2) is a compound useful in organic synthesis. |
| | 4-METHOXY-2,3,6-TRIMETHYL-BENZALDEHYDE Preparation Products And Raw materials |
|