- Diethyl pimelate
-
-
2025-04-04
- CAS:2050-20-6
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1Ton
- Diethyl pimelate
-
-
2020-02-26
- CAS: 2050-20-6
- Min. Order: 100G
- Purity: 99.0%+
- Supply Ability: 100 tons
- Diethyl pimelate
-
- $1.00
-
2019-07-06
- CAS:2050-20-6
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 150KG
|
| | Diethyl pimelate Basic information |
| | Diethyl pimelate Chemical Properties |
| Melting point | -24°C | | Boiling point | 192-194 °C100 mm Hg(lit.) | | density | 0.994 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.430(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | 1.97g/l slightly soluble | | form | Oil | | color | Colourless | | Merck | 14,7431 | | Henry's Law Constant | 2.2×101 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) | | InChI | InChI=1S/C11H20O4/c1-3-14-10(12)8-6-5-7-9-11(13)15-4-2/h3-9H2,1-2H3 | | InChIKey | LKKOGZVQGQUVHF-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)CCCCCC(OCC)=O | | CAS DataBase Reference | 2050-20-6(CAS DataBase Reference) | | NIST Chemistry Reference | Diethyl pimelate(2050-20-6) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | RTECS | UV9702000 | | HS Code | 29171990 |
| | Diethyl pimelate Usage And Synthesis |
| Chemical Properties | CLEAR COLORLESS LIQUID |
| | Diethyl pimelate Preparation Products And Raw materials |
|