- L-Phg-Ome
-
-
2026-07-24
- CAS:15028-39-4
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- H-PHG-OMEHCL
-
- $5.90
-
2022-02-25
- CAS:15028-39-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10kg
|
| | H-PHG-OME HCL Basic information |
| | H-PHG-OME HCL Chemical Properties |
| Melting point | 200 °C (dec.)(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | Solid | | color | White to off-white | | Optical Rotation | [α]20/D +120°, c = 1 in H2O | | Major Application | peptide synthesis | | InChI | InChI=1S/C9H11NO2.ClH/c1-12-9(11)8(10)7-5-3-2-4-6-7;/h2-6,8H,10H2,1H3;1H/t8-;/m0./s1 | | InChIKey | DTHMTBUWTGVEFG-QRPNPIFTSA-N | | SMILES | [C@@H](C1C=CC=CC=1)(N)C(=O)OC.Cl |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids |
| | H-PHG-OME HCL Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | (S)-(+)-2-Phenylglycine Methyl Ester Hydrochloride can be used to prepare beta-lactam antibiotic ampicillin. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | H-PHG-OME HCL Preparation Products And Raw materials |
|