|
|
| | 3-(PERFLUOROOCTYL)PROPANOL Basic information |
| Product Name: | 3-(PERFLUOROOCTYL)PROPANOL | | Synonyms: | 1H,1H,2H,2H,3H,3H-PERFLUOROUNDECAN-1-OL;1H,1H,2H,2H,3H,3H-PERFLUOROUNDECANOL;3-(PERFLUOROOCTYL)PROPAN-1-OL;3-(PERFLUOROOCTYL)PROPANOL;DAIKIN A-1830;3-(Perfluorooct-1-yl)propan-1-ol;Perfluoroundecanol;4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-1-undecanol | | CAS: | 1651-41-8 | | MF: | C11H7F17O | | MW: | 478.15 | | EINECS: | | | Product Categories: | | | Mol File: | 1651-41-8.mol |  |
| | 3-(PERFLUOROOCTYL)PROPANOL Chemical Properties |
| Melting point | 42 °C | | Boiling point | 106 °C | | density | 1.590±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 14.84±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C11H7F17O/c12-4(13,2-1-3-29)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)28/h29H,1-3H2 | | InChIKey | FQTWAKFTSLUFFS-UHFFFAOYSA-N | | SMILES | C(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 1651-41-8(CAS DataBase Reference) | | EPA Substance Registry System | 3-(Perfluorooctyl)propanol (1651-41-8) |
| Hazard Codes | Xi | | Hazard Note | Irritant |
| | 3-(PERFLUOROOCTYL)PROPANOL Usage And Synthesis |
| Uses | 3-(Perfluorooctyl)propan-1-olis is used in preparation of fluoroalkyl vinyl ether by reaction of fluorinated alcohol with divinyl ether and/or trivinyl ether. |
| | 3-(PERFLUOROOCTYL)PROPANOL Preparation Products And Raw materials |
|