| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:3-Methyluric Acid
CAS:605-99-2
Package:250Mg,25Mg
|
|
| | 3-METHYLURIC ACID Basic information |
| Product Name: | 3-METHYLURIC ACID | | Synonyms: | 4,9-dihydro-3-methyl-1H-purine-2,6,8(3H)-trione;3-methyl-7,9-dihydropurine-2,6,8-trione;1H-Purine-2,6,8(3H)-trione, 7,9-dihydro-3-methyl- | | CAS: | 605-99-2 | | MF: | C6H6N4O3 | | MW: | 182.14 | | EINECS: | 2101013 | | Product Categories: | | | Mol File: | 605-99-2.mol |  |
| | 3-METHYLURIC ACID Chemical Properties |
| Melting point | >349.85°C | | Boiling point | 315.51°C (rough estimate) | | density | 1.6104 | | refractive index | 1.6334 (estimate) | | solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) | | form | Solid | | color | Pale Yellow to Light Yellow | | InChI | InChI=1S/C6H6N4O3/c1-10-3-2(7-5(12)8-3)4(11)9-6(10)13/h1H3,(H2,7,8,12)(H,9,11,13) | | InChIKey | ODCYDGXXCHTFIR-UHFFFAOYSA-N | | SMILES | N1C2=C(N(C)C(=O)NC2=O)NC1=O |
| | 3-METHYLURIC ACID Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | 3-Methyluric Acid is a methylated derivative of uric acid that inhibits peroxynitrite-mediated oxidation, which has potential therapeutic application in the treatment of multiple sclerosis. 3-Methyluric Acid is also a known metabolite of Caffeine (C080100). | | Definition | ChEBI: 3-Methyluric acid is an oxopurine. |
| | 3-METHYLURIC ACID Preparation Products And Raw materials |
|