SR-4835 manufacturers
- SR-4835
-
-
2026-07-07
- CAS:2387704-62-1
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1000kg
|
| | SR-4835 Basic information |
| Product Name: | SR-4835 | | Synonyms: | SR-4835;9H-Purin-6-amine, N-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]-9-(1-methyl-1H-pyrazol-4-yl)-2-(4-morpholinyl)-;Cyclin dependent kinase,SR-4835,inhibit,CDK,Apoptosis,SR4835,Inhibitor,SR 4835;N-[(5,6-Dichloro-2-benzoimidazolyl)methyl]-9-(1-methyl-4-pyrazolyl)-2-morpholino-9H-purin-6-amine;N-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]-9-(1-methyl-1H-pyrazol-4-yl)-2-(4-morpholinyl)-9H-purin-6-amine;SR-4835, 10 mM in DMSO;SR-4853 | | CAS: | 2387704-62-1 | | MF: | C21H20Cl2N10O | | MW: | 499.36 | | EINECS: | | | Product Categories: | | | Mol File: | 2387704-62-1.mol |  |
| | SR-4835 Chemical Properties |
| Boiling point | 886.6±75.0 °C(Predicted) | | density | 1.72±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO:5.0(Max Conc. mg/mL);10.0(Max Conc. mM) | | form | Solid | | pka | 9.13±0.30(Predicted) | | color | Off-white to light brown | | InChIKey | FSELUFUYNUNZKD-UHFFFAOYSA-N | | SMILES | N1C2C(=NC(N3CCOCC3)=NC=2NCC2NC3=CC(Cl)=C(Cl)C=C3N=2)N(C2=CN(C)N=C2)C=1 |
| | SR-4835 Usage And Synthesis |
| Uses | SR-4835 is a potent, highly selective and ATP competitive dual inhibitor of CDK12/CDK13 (CDK12: IC50=99 nM, Kd=98 nM; CDK13: Kd=4.9 nM). SR-4835 acts in synergy with DNA-damaging chemotherapy and PARP inhibitors and provokes triple-negative breast cancer (TNBC) cell death[1]. | | IC 50 | CDK12: 99 nM (IC50); CDK12: 98 nM (Kd); CDK13: 4.9 nM (Kd) | | References | [1] Quereda V, et al. Therapeutic Targeting of CDK12/CDK13 in Triple-Negative Breast Cancer. Cancer Cell. 2019 Oct 8. pii: S1535-6108(19)30424-6. DOI:10.1016/j.ccell.2019.09.004 |
| | SR-4835 Preparation Products And Raw materials |
|