| Company Name: |
Shanghai Hongye Biotechnology Co. Ltd
|
| Tel: |
400-9205774 400-920-5774 |
| Email: |
sales@glpbio.cn |
| Products Intro: |
Product Name:Naltrexone-d3 CAS:1261080-26-5 Purity:>98% Package:1mg;10mg;50mg;100mg;
|
| Company Name: |
TOSUN PHARM
|
| Tel: |
020-66392521-118 18922260391 |
| Email: |
3004261881@qq.com |
| Products Intro: |
Product Name:NALTREXONE-D3 CAS:1261080-26-5 Purity:98%以上 Package:10mg;50mg;100mg等多種規(guī)格 Remarks:REF-N07016
|
| Company Name: |
ChemeGen(Shanghai) Biotechnology Co.,Ltd.
|
| Tel: |
18818260767 |
| Email: |
sales@chemegen.com |
| Products Intro: |
Product Name:Naltrexone-d3 (CRM) CAS:1261080-26-5 Purity:98% Package:10 mg;50 mg;100 mg;500 mg;1 g;5 g;10 g
|
| Company Name: |
Hubei Xinyang Medical Technology Co., Ltd
|
| Tel: |
15347293736 |
| Email: |
2853117764@yongstandards.com |
| Products Intro: |
Product Name:NALTREXONE-D3 CAS:1261080-26-5 Purity:99% HPLC Package:10mg;25mg;50mg;100mg;200mg;500mg
|
|
| | NALTREXONE-D3 Basic information |
| | NALTREXONE-D3 Chemical Properties |
| Melting point | 148-1500C | | Fp | 9℃ | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Pale Yellow | | Major Application | pharmaceutical (small molecule) | | InChIKey | DQCKKXVULJGBQN-VOVHGNGRSA-N | | SMILES | [2H]C([2H])(N1CC[C@]23[C@H]4Oc5c(O)ccc(C[C@@H]1[C@]2(O)CCC4=O)c35)C6([2H])CC6 |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
| | NALTREXONE-D3 Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | Nonselective opioid receptor antagonist; congener of Naloxone. |
| | NALTREXONE-D3 Preparation Products And Raw materials |
|