POLY(BENZYL METHACRYLATE) manufacturers
|
| | POLY(BENZYL METHACRYLATE) Basic information |
| | POLY(BENZYL METHACRYLATE) Chemical Properties |
| density | 1.179 g/mL at 25 °C (lit.) | | Tg | 54 | | refractive index | n20/D 1.568(lit.) | | form | powder | | InChI | InChI=1S/C11H12O2/c1-9(2)11(12)13-8-10-6-4-3-5-7-10/h3-7H,1,8H2,2H3 | | InChIKey | AOJOEFVRHOZDFN-UHFFFAOYSA-N | | SMILES | C(C1C=CC=CC=1)OC(=O)C(=C)C |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 39069090 | | Storage Class | 11 - Combustible Solids |
| | POLY(BENZYL METHACRYLATE) Usage And Synthesis |
| Chemical Properties | white solid | | Uses | A variety of morphologies can be obtained by preparing poly(benzyl methacrylate)(PBzMA)/epoxy thermoset polymer blends of different compositions. The changing morphology is known to have an influence on the dynamic mechanical properties of the polymer blend. These thermoset blends find uses as matrix materials for composites and coatings. | | Solubility in organics | Benzene, chloroform, dioxane, THF, toluene |
| | POLY(BENZYL METHACRYLATE) Preparation Products And Raw materials |
|