- Isoimperatorin
-
- $97.00
-
2026-07-17
- CAS:482-45-1
- Purity: 99.24%
- Supply Ability: 10g
- Isoimperatorin
-
-
2023-02-24
- CAS:482-45-1
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | Isoimperatorin Basic information |
| | Isoimperatorin Chemical Properties |
| Melting point | 107-111°C | | Boiling point | 448.3±45.0 °C(Predicted) | | density | 1.242±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly | | form | Solid | | color | White to Pale Yellow | | BRN | 1291723 | | Major Application | food and beverages | | InChI | 1S/C16H14O4/c1-10(2)5-7-19-16-11-3-4-15(17)20-14(11)9-13-12(16)6-8-18-13/h3-6,8-9H,7H2,1-2H3 | | InChIKey | IGWDEVSBEKYORK-UHFFFAOYSA-N | | SMILES | O=C1C=CC(C(OCC=C(C)C)=C(C=CO2)C2=C3)=C3O1 | | LogP | 3.495 (est) | | CAS DataBase Reference | 482-45-1(CAS DataBase Reference) | | NIST Chemistry Reference | 7H-furo[3,2-g][1]benzopyran-7-one, 4-[(3-methyl-2-butenyl)oxy]-(482-45-1) |
| | Isoimperatorin Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Anti-inflammatory. Effect on proliferation. | | Definition | ChEBI: A member of the class of psoralens that is psoralen substituted by a prenyloxy group at position 5. Isolated from Angelica dahurica and Angelica koreana, it acts as a acetylcholinesterase inhibitor. | | IC 50 | AChE |
| | Isoimperatorin Preparation Products And Raw materials |
|