(R)-(S)-BPPFA manufacturers
- (R)-(S)-BPPFA
-
- $1.00
-
2020-01-09
- CAS:74311-56-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100KG
|
| | (R)-(S)-BPPFA Basic information |
| Product Name: | (R)-(S)-BPPFA | | Synonyms: | (R)-(S)-BPPFA;(-)-(R)-N,N-DIMETHYL-1-[(S)-1',2-BIS(DIPHENYLPHOSPHINO)FERROCENYL]ETHYLAMINE;(-)-(R)-N,N-dimethyl-1-((S)-1',2-bis(di-phenylpho;(-)-(R)-N,N-DIMETHYL-1-((S)-1',2-BIS(DI- PHENYLPHOSPHINO)FERROCENYL)ET-AMIN,95%;(R)-N,N-Dimethyl-1-((S)-1',2-bis(diphenylphosphino;[r,r]-1-[1-dimethylaminoethyl]-1',2-bis[diphenylphosphino]ferrocene;N,N-dimethyl-1-[1,2-bis(diphenylphosphino)ferrocenyl]ethyl;(2S)-1-[(1R)-1-(Dimethylamino)ethyl]-1',2-bis(diphenylphosphino)ferrocene | | CAS: | 74311-56-1 | | MF: | C38H37FeNP210* | | MW: | 625.5 | | EINECS: | | | Product Categories: | Chiral Phosphine;Asymmetric Synthesis;Classes of Metal Compounds;Fe (Iron) Compounds;Ferrocenes;Metallocenes;Phosphine Ligands;Synthetic Organic Chemistry;Transition Metal Compounds | | Mol File: | 74311-56-1.mol |  |
| | (R)-(S)-BPPFA Chemical Properties |
| Melting point | 143-144 °C(lit.) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | solid | | color | Light yellow to Brown | | Optical Rotation | [α]20/D 350°, c = 0.5 in chloroform | | InChIKey | VUJPTJYMSBMZOZ-ZEECNFPPSA-N | | SMILES | [Fe].[CH]1[CH][CH][C]([CH]1)P(c2ccccc2)c3ccccc3.C[C@H]([C]4[CH][CH][CH][C]4P(c5ccccc5)c6ccccc6)N(C)C |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2931.90.6000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (R)-(S)-BPPFA Usage And Synthesis |
| Uses | (-)-(R)-(S)-BPPFA is an electron-rich bulky ligand used in amination reactions of aryl halides and tosylates. Homogeneous catalyst. | | Uses | Ligand used in the enantioselective silylation of allylic chlorides. |
| | (R)-(S)-BPPFA Preparation Products And Raw materials |
|