|
|
| | Trimethylphenylammonium chloride Basic information |
| Product Name: | Trimethylphenylammonium chloride | | Synonyms: | Ammonium, trimethylphenyl-, chloride;Ammonyx 200;ammonyx200;Benzenaminium, N,N,N-trimethyl-, chloride;Benzenaminium,N,N,N-trimethyl-,chloride;n,n,n-trimethyl-benzenaminiuchloride;n,n,n-trimethylbenzenaminiumchloride;PHENYLTRIMETHYLAMMONIUM CHLORIDE FOR SYN | | CAS: | 138-24-9 | | MF: | C9H14ClN | | MW: | 171.67 | | EINECS: | 205-319-0 | | Product Categories: | Ammonium Chlorides (Quaternary);Quaternary Ammonium Compounds;K00001 | | Mol File: | 138-24-9.mol |  |
| | Trimethylphenylammonium chloride Chemical Properties |
| Melting point | 246-248 °C (dec.) (lit.) | | Boiling point | 283.2°C (rough estimate) | | density | 1.0683 (rough estimate) | | bulk density | 540kg/m3 | | vapor pressure | 0Pa at 25℃ | | refractive index | 1.6224 (estimate) | | storage temp. | Store below +30°C. | | solubility | H2O: 0.1 g/mL, clear | | form | Solid | | color | White crystalline | | PH Range | 4.5 | | PH | 4.5 (333g/l, H2O, 20℃) | | explosive limit | 1-6%(V) | | Water Solubility | soluble | | Sensitive | Hygroscopic | | BRN | 3572527 | | InChI | 1S/C9H14N.ClH/c1-10(2,3)9-7-5-4-6-8-9;/h4-8H,1-3H3;1H/q+1;/p-1 | | InChIKey | MQAYPFVXSPHGJM-UHFFFAOYSA-M | | SMILES | [Cl-].C[N+](C)(C)c1ccccc1 | | LogP | 0.542 at 25℃ | | CAS DataBase Reference | 138-24-9(CAS DataBase Reference) | | NIST Chemistry Reference | Trimethylphenylammonium chloride(138-24-9) | | EPA Substance Registry System | Benzenaminium, N,N,N-trimethyl-, chloride (138-24-9) |
| Hazard Codes | T | | Risk Statements | 24/25 | | Safety Statements | 53-25-39-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 1 | | RTECS | BT2190000 | | Autoignition Temperature | 237°C | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29239000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Oral
Aquatic Chronic 3 | | Toxicity | LD50 orally in Rabbit: 121 mg/kg LD50 dermal Rabbit 309 mg/kg |
| | Trimethylphenylammonium chloride Usage And Synthesis |
| Chemical Properties | White or greyish-bleu crystalline powder | | Uses | Phenyltrimethylammonium chloride is an effective phase transfer catalyst, methylating agent, also useful for alkaline depolymerizations, corrosion inhibitor for low carbon steel. | | Flammability and Explosibility | Non flammable |
| | Trimethylphenylammonium chloride Preparation Products And Raw materials |
|