| Company Name: |
Finetech Industry Limited
|
| Tel: |
027-87465837 19945049750 |
| Email: |
sales@finetechnology-ind.com |
| Products Intro: |
Product Name:Quintrione
CAS:1350901-36-8
Purity:98% Package:1g;5g;25g;500g;1kg
|
|
| | Quintrione Basic information |
| Product Name: | Quintrione | | Synonyms: | Quintrione;1,3-Cyclohexanedione, 2-[(3,7-dichloro-8-quinolinyl)carbonyl]-;Quintrione in Acetonitrile | | CAS: | 1350901-36-8 | | MF: | C16H11Cl2NO3 | | MW: | 336.17 | | EINECS: | | | Product Categories: | | | Mol File: | 1350901-36-8.mol |  |
| | Quintrione Chemical Properties |
| Melting point | 142-145°C | | Boiling point | 514.3±50.0 °C(Predicted) | | density | 1.476±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Chloroform (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 2.46±0.25(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C16H11Cl2NO3/c17-9-6-8-4-5-10(18)13(15(8)19-7-9)16(22)14-11(20)2-1-3-12(14)21/h4-7,14H,1-3H2 | | InChIKey | SZPMWKUJLQEAEL-UHFFFAOYSA-N | | SMILES | C1(=O)CCCC(=O)C1C(C1=C2C(=CC=C1Cl)C=C(Cl)C=N2)=O |
| | Quintrione Usage And Synthesis |
| Uses | Quintrione is herbicidal compound comprising Heterocyclic Amide compound and use thereof. |
| | Quintrione Preparation Products And Raw materials |
|