- Pleconaril
-
- $32.00
-
2026-05-11
- CAS:153168-05-9
- Purity: 99.88%
- Supply Ability: 10g
- PLECONARIL USP/EP/BP
-
- $1.10
-
2025-11-18
- CAS:153168-05-9
- Min. Order: 1g
- Purity: 99.9%
- Supply Ability: 100 Tons Min
- PLECONARIL
-
-
2019-12-20
- CAS:153168-05-9
- Min. Order: 1KG
- Purity: 99%
|
| | PLECONARIL Basic information |
| Product Name: | PLECONARIL | | Synonyms: | WIN 63843;3-[3,5-Dimethyl-4-[3-(3-methyl-5-isoxazolyl)propoxy]phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole;Picovir;3-[3,5-DiMethyl-4-[3-(3-Methyl-5-isoxazolyl)propoxy]phenyl]-5-(trifluoroMethyl)-;1,2,4-Oxadiazole,3-[3,5-diMethyl-4-[3-(3-Methyl-5-isoxazolyl)propoxy]phenyl]-5-(trifluoroMethyl)-;VP 63843;3-(3,5-dimethyl-4-(3-(3-methylisoxazol-5-yl)propoxy)phenyl)-5-(trifluoromethyl)-1,2,4-oxadiazole;PLECONARIL | | CAS: | 153168-05-9 | | MF: | C18H18F3N3O3 | | MW: | 381.35 | | EINECS: | | | Product Categories: | Anti-virals;Heterocycles;Inhibitors;Intermediates & Fine Chemicals;Pharmaceuticals;API | | Mol File: | 153168-05-9.mol |  |
| | PLECONARIL Chemical Properties |
| Melting point | 61-62° | | Boiling point | 481.2±55.0 °C(Predicted) | | density | 1.271 | | storage temp. | room temp | | solubility | DMSO: ≥10mg/mL (warmed) | | form | powder | | pka | -1.33±0.10(Predicted) | | color | white to beige | | InChI | 1S/C18H18F3N3O3/c1-10-7-13(16-22-17(27-24-16)18(19,20)21)8-11(2)15(10)25-6-4-5-14-9-12(3)23-26-14/h7-9H,4-6H2,1-3H3 | | InChIKey | KQOXLKOJHVFTRN-UHFFFAOYSA-N | | SMILES | Cc1cc(CCCOc2c(C)cc(cc2C)-c3noc(n3)C(F)(F)F)on1 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 4 |
| | PLECONARIL Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Pleconaril has been used as a control or reference compound to assess the antiviral activities of the benzothiophene and other heteroaromatic derivatives against hRV-B14, hRV-A21 and hRV-A71. | | Uses | Picornavirus replication inhibitor. Antiviral. | | General Description | Pleconaril is a drug, that has antiviral activity. | | Pharmaceutical Applications | An oxadiazole active against most enteroviruses and rhinoviruses.
It binds to the hydrophobic pocket of the virus capsid
protein VP1, inducing conformational changes that lead to
altered receptor binding and viral uncoating. Concerns over
safety and efficacy have constrained development of the drug. | | Biochem/physiol Actions | Pleconaril is an effective drug against enteroviral infections. It can be used to treat chronic meningoencephalitis caused by echo virus 6.This can block viral replication by blocking the viral uncoating process and viral attachment to host cell receptors. |
| | PLECONARIL Preparation Products And Raw materials |
|