|
|
| | 2-Butyl-1,2-benzisothiazolin-3-one Basic information |
| Product Name: | 2-Butyl-1,2-benzisothiazolin-3-one | | Synonyms: | -butyl-1,2-benzisothiazolin-3-one(BBIT);2-Butyl-1,2-benzothiazol-3-one;2-butyl-1,2-benzisothiazolin-3-one;2-Butyl-1,2-Benziso-Thiazol-3(2h)-One;2-n-Butyl-1,2-benzisothiazolin-3-on;2-BUTYL-BENZO(D)ISOTHIAZOLIN-3-ONE;2-n-Butyl-benzo[d]isothiazol-3-one;2-BENZISOTHIAZOL-3(2H)-ONE, 2-BUTYL-1 | | CAS: | 4299-07-4 | | MF: | C11H13NOS | | MW: | 207.29 | | EINECS: | 1312995-182-4 | | Product Categories: | biocide;Preservative | | Mol File: | 4299-07-4.mol |  |
| | 2-Butyl-1,2-benzisothiazolin-3-one Chemical Properties |
| Melting point | 137-138° | | Boiling point | 332.9±25.0 °C(Predicted) | | density | 1.176±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Methanol (Slightly) | | form | clear liquid | | pka | -2.10±0.20(Predicted) | | color | Light yellow to Yellow to Orange | | InChI | InChI=1S/C11H13NOS/c1-2-3-8-12-11(13)9-6-4-5-7-10(9)14-12/h4-7H,2-3,8H2,1H3 | | InChIKey | LUYIHWDYPAZCNN-UHFFFAOYSA-N | | SMILES | S1C2=C(C=CC=C2)C(=O)N1CCCC | | CAS DataBase Reference | 4299-07-4(CAS DataBase Reference) | | EPA Substance Registry System | 2-Butyl-1,2-benzisothiazolin-3(2H)-one (4299-07-4) |
| RIDADR | UN1760 | | HS Code | 2934.20.8000 | | HazardClass | 8 |
| | 2-Butyl-1,2-benzisothiazolin-3-one Usage And Synthesis |
| Uses | 2-Butyl-1,2-benzisothiazolin-3-one is a heterocyclic organic compound and can be used as a pharmaceutical intermediate. |
| | 2-Butyl-1,2-benzisothiazolin-3-one Preparation Products And Raw materials |
|