|
|
| | (S)-5-bromo-6-methoxy-alpha-methylnaphthalene-1-acetic acid Basic information |
| | (S)-5-bromo-6-methoxy-alpha-methylnaphthalene-1-acetic acid Chemical Properties |
| Melting point | 155-157 °C | | Boiling point | 446.2±30.0 °C(Predicted) | | density | 1.483±0.06 g/cm3(Predicted) | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | pka | 4.72±0.30(Predicted) | | form | Solid | | color | Pale Beige | | Major Application | pharmaceutical | | InChI | 1S/C14H13BrO3/c1-8(14(16)17)9-3-5-11-10(7-9)4-6-12(18-2)13(11)15/h3-8H,1-2H3,(H,16,17)/t8-/m0/s1 | | InChIKey | JZRWXNBIQCMXSU-QMMMGPOBSA-N | | SMILES | C[C@H](C(O)=O)C1=CC2=CC=C(OC)C(Br)=C2C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 Repr. 2 Skin Irrit. 2 STOT SE 3 |
| | (S)-5-bromo-6-methoxy-alpha-methylnaphthalene-1-acetic acid Usage And Synthesis |
| Uses | (S)-5-Bromo Naproxen is an impurity of (S)-Naproxen (N377520). |
| | (S)-5-bromo-6-methoxy-alpha-methylnaphthalene-1-acetic acid Preparation Products And Raw materials |
|