| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
| Products Intro: |
Product Name:(4As,6ar,6as,6br,8ar,9s,10s,12ar,14bs)-9-formyl-10-hydroxy-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid CAS:639-14-5 Purity:96%
|
|
|
|
|
(3beta,4alpha)-3-hydroxy-23-oxoolean-12-en-28-oic acid manufacturers
- Gypsogenin
-
- $136.00
-
2026-07-15
- CAS:639-14-5
- Purity: 99.73%
- Supply Ability: 10g
|
| | (3beta,4alpha)-3-hydroxy-23-oxoolean-12-en-28-oic acid Basic information |
| Product Name: | (3beta,4alpha)-3-hydroxy-23-oxoolean-12-en-28-oic acid | | Synonyms: | Einecs 211-353-7;Githagenin;Gypsophila paniculata saponin (swiss standard saponin);(3beta,4alpha)-3-hydroxy-23-oxoolean-12-en-28-oic acid;Astrantiagenin D;GYPSOPHILASAPONIN;GITHAGENINE;3β-Hydroxy-23-oxoolean-12-en-28-oic acid | | CAS: | 639-14-5 | | MF: | C30H46O4 | | MW: | 470.68 | | EINECS: | 211-353-7 | | Product Categories: | | | Mol File: | 639-14-5.mol |  |
| | (3beta,4alpha)-3-hydroxy-23-oxoolean-12-en-28-oic acid Chemical Properties |
| Melting point | 274-276° | | alpha | D +91° (alc) | | Boiling point | 492.11°C (rough estimate) | | density | 0.9967 (rough estimate) | | refractive index | 1.4800 (estimate) | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.624±0.70(predicted) | | color | White to Off-White | | InChIKey | QMHCWDVPABYZMC-OYJAYYCPNA-N | | SMILES | [C@@H]1(O)[C@@](C2[C@](C)(CC1)[C@]1([H])[C@@]([C@]3(C(=CC1)[C@@]1([C@@](CCC(C1)(C)C)(C(O)=O)CC3)[H])C)(C)CC2)(C)C=O |&1:0,2,4,8,10,11,15,16,r| |
| | (3beta,4alpha)-3-hydroxy-23-oxoolean-12-en-28-oic acid Usage And Synthesis |
| Uses | Gypsogenin was one of the substances used for identification of virulence inhibitors from Brazilian Schinus terebinthifolius which blocks quorum sensing and abate dermonecrosis in skin infection mouse model and human keratinocytes. | | Definition | ChEBI: A sapogenin that is olean-12-en-28-oic acid substituted by a beta-hydroxy group at position 3 and an oxo group at position 23. |
| | (3beta,4alpha)-3-hydroxy-23-oxoolean-12-en-28-oic acid Preparation Products And Raw materials |
|