|
|
| | Dimethyl Thiodiglycolate Basic information |
| Product Name: | Dimethyl Thiodiglycolate | | Synonyms: | dimethyl 2,2'-thiobisacetate;2,2'-Thiobis(acetic acid methyl) ester;2,2'-Thiobis(acetic acid)dimethyl ester;2,2'-Thiodiacetic acid dimethyl ester;Thiobis(acetic acid methyl) ester;Thiodiacetic acid dimethyl ester;Thiodiglycolic acid dimethyl;Einecs 240-135-4 | | CAS: | 16002-29-2 | | MF: | C6H10O4S | | MW: | 178.21 | | EINECS: | 240-135-4 | | Product Categories: | | | Mol File: | 16002-29-2.mol |  |
| | Dimethyl Thiodiglycolate Chemical Properties |
| Boiling point | 130 °C(Press: 15 Torr) | | density | 1.199±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C6H10O4S/c1-9-5(7)3-11-4-6(8)10-2/h3-4H2,1-2H3 | | InChIKey | ZQUQLLPRRJVUES-UHFFFAOYSA-N | | SMILES | S(CC(OC)=O)CC(OC)=O |
| | Dimethyl Thiodiglycolate Usage And Synthesis |
| Chemical Properties | Pale yellow to colorless liquid | | Synthesis |
Preparation method of dimethyl thiodiacetate: chloroacetic acid is used as raw material, and it is obtained by the 3-step reaction of methyl esterification, thiolation, and iodine oxidative coupling.
|
| | Dimethyl Thiodiglycolate Preparation Products And Raw materials |
|