| Company Name: |
Shanghai Tauto Biotech Co., Ltd.
|
| Tel: |
021-51320588 |
| Email: |
tauto@tautobiotech.com |
| Products Intro: |
Product Name:SABINENE HYDRATE(SG)
CAS:546-79-2
Purity:NLT 95% HPLC Package:10Mg;20Mg;50Mg;100Mg to graMs.Not More than tens of graMs. Remarks:ASB-00019002-100
|
|
| | 4-THUJANOL Basic information |
| Product Name: | 4-THUJANOL | | Synonyms: | 4-Methyl-1-(1-methylethyl)bicyclo[3.1.0]hexan-4-ol;C02462;RUTINOSE HEPTAACETATE(RG);Sabinene hydrate,4-Thujanol;2-methyl-5-(1-methylethyl)-bicyclo[3.1.0]hexan-2-o;2-Methyl-5-(1-methylethyl)bicyclo[3.1.0]hexan-2-ol;Bicyclo[3.1.0]hexan-2-ol,2-methyl-5-(1-methylethyl)-;c-sabinene hydrate | | CAS: | 546-79-2 | | MF: | C10H18O | | MW: | 154.25 | | EINECS: | 208-911-7 | | Product Categories: | | | Mol File: | 546-79-2.mol |  |
| | 4-THUJANOL Chemical Properties |
| Melting point | 58-62 °C | | Boiling point | 201.7±8.0 °C(Predicted) | | density | 1.030±0.06 g/cm3(Predicted) | | FEMA | 3239 | 4-THUJANOL | | storage temp. | -20°C | | solubility | Chloroform, Ethanol (Slightly), Hexanes (Slightly) | | pka | 15.22±0.40(Predicted) | | color | Off-White | | Odor | at 1.00 % in dipropylene glycol. minty eucalyptus green terpene | | Odor Type | herbal | | Optical Rotation | [α]20/D +31.5±2°, c = 1% in ethanol | | JECFA Number | 441 | | Major Application | cleaning products
cosmetics
flavors and fragrances
food and beverages
personal care | | Cosmetics Ingredients Functions | PERFUMING | | InChI | 1S/C10H18O/c1-7(2)10-5-4-9(3,11)8(10)6-10/h7-8,11H,4-6H2,1-3H3/t8-,9+,10+/m0/s1 | | InChIKey | KXSDPILWMGFJMM-IVZWLZJFSA-N | | SMILES | CC(C)[C@@]12CCC(C)(O)[C@@H]1C2 | | LogP | 2.53 | | EPA Substance Registry System | Bicyclo[3.1.0]hexan-2-ol, 2-methyl-5-(1-methylethyl)- (546-79-2) |
| WGK Germany | 3 | | F | 8-10-23 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | 4-THUJANOL Usage And Synthesis |
| Chemical Properties | Thujan-4-ol has an odor reminiscent of terpineol. | | Occurrence | Reported found in peppermint oil (trans-form), lemon juice, mandarin peel oil, mandarin, nutmeg, peppermint,
rosemary, scotch spearmint, tarragon, thyme, black currant (buds), Vitis vinifera L., ginger, spearmint oil, other Mentha oils, pepper,
sweet marjoram, cardamom, origanum, dill herb, Oscimum basilicum varieties and laurel. | | Uses | Sabinene Hydrate is a monoterpene and an essential oil component, found to have antifungal activity. | | Uses | cis-4-Thujanol is a related compound of (+)-Sabinene (S080750), a component of juniper berry oil having antibacterial and antifungal activity. | | Definition | ChEBI: Sabinene hydrate is a p-menthane monoterpenoid. | | Aroma threshold values | Aroma characteristics at 1.0%: earthy camphoreous pine and turpentine-like with citrus grapefruit nuances. | | Taste threshold values | Taste characteristics at 5 ppm: woody, citrus orange and grapefruit-like. | | Synthesis | The Grignard reaction with sabina ketone yields two isomers, of which one is identical to an alcohol isolated from
American peppermint oil; synthetic routes for the preparation of both the cis- and trans-form are also available. |
| | 4-THUJANOL Preparation Products And Raw materials |
|