3-FLUORO-DL-TYROSINE manufacturers
|
| | 3-FLUORO-DL-TYROSINE Basic information |
| Product Name: | 3-FLUORO-DL-TYROSINE | | Synonyms: | 3-Fluoro-DL-tyrosine,96%;rac-(2R*)-2-(3-Fluoro-4-hydroxybenzyl)glycine;3-Fluoro-DL-tyrosine,99%;3-fluoro-DL-tryrosine;DL-3-Fluorotyrosin;NSC 83231;2-Amino-3-(3-fluoro-4-hydroxyphenyl)propanoic acid, 3-Fluoro-4-hydroxy-DL-phenylalanine;ba2745 | | CAS: | 403-90-7 | | MF: | C9H10FNO3 | | MW: | 199.18 | | EINECS: | 206-964-0 | | Product Categories: | A - H;Amino Acids;Modified Amino Acids | | Mol File: | 403-90-7.mol |  |
| | 3-FLUORO-DL-TYROSINE Chemical Properties |
| Melting point | 280 °C (dec.) (lit.) | | Boiling point | 362.4±42.0 °C(Predicted) | | density | 1.2523 (estimate) | | storage temp. | 2-8°C | | form | powder | | pka | 2.21±0.20(Predicted) | | color | white | | Water Solubility | Soluble in water (28 g/L). | | BRN | 3204804 | | Stability: | Stable. Incompatible with strong reducing agents, strong oxidizing agents. | | InChI | 1S/C9H10FNO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14) | | InChIKey | VIIAUOZUUGXERI-UHFFFAOYSA-N | | SMILES | NC(Cc1ccc(O)c(F)c1)C(O)=O | | CAS DataBase Reference | 403-90-7(CAS DataBase Reference) |
| Hazard Codes | Xn,T | | Risk Statements | 20/21/22 | | Safety Statements | 36 | | RIDADR | 3276 | | WGK Germany | 3 | | RTECS | YP2660000 | | Hazard Note | Toxic | | HazardClass | 6.1 | | PackingGroup | II | | HS Code | 2922500090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral |
| | 3-FLUORO-DL-TYROSINE Usage And Synthesis |
| Chemical Properties | white solid | | Uses | 3-Fluoro-DL-tyrosine is used for tyrosine in the biosynthesis of proteins such as β-galactosidases (Escherichia coli), bacteriorhodopsin and intestinal microvillar enzymes, aminopeptidase N, to study the effect of halogenated tryosines on the proteins properties. | | Definition | ChEBI: 3-fluorotyrosine is a fluoroamino acid, a tyrosine derivative, a non-proteinogenic alpha-amino acid and a fluorophenol. It is functionally related to a tyrosine. | | Biochem/physiol Actions | M-Fluorotyrosine (m-Fluoro-DL-tyrosine) may be substituted for tyrosine in the biosynthesis of proteins such as β-galactosidases (Escherichia coli), bacteriorhodopsin and intestinal microvillar enzymes, eg. aminopeptidase N, to study the effect of halogenated tryosines on the proteins properties. |
| | 3-FLUORO-DL-TYROSINE Preparation Products And Raw materials |
|