TanshinoneIIB manufacturers
- TanshinoneIIB
-
- $1.00
-
2020-01-13
- CAS:17397-93-2
- Min. Order: 1KG
- Purity: 98%HPLC
- Supply Ability: 10 tons
|
| | TanshinoneIIB Basic information |
| Product Name: | TanshinoneIIB | | Synonyms: | Tanshine IIB;(S)-6-(HydroxyMethyl)-1,6-diMethyl-6,7,8,9-tetrahydrophenanthro[1,2-b]furan-10,11-dione;-1,6-dimethyl-6,7,8,9-tetrahydrophenanthro[1,2-b]furan-10,11-dione;Phenanthro[1,2-b]furan-10,11-dione, 6,7,8,9-tetrahydro-6-(hydroxymethyl)-1,6-dimethyl-, (6S)-;(6S)-6-(hydroxymethyl)-1,6-dimethyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-10,11-dione;TanshinoneⅡB | | CAS: | 17397-93-2 | | MF: | C19H18O4 | | MW: | 310.34 | | EINECS: | | | Product Categories: | Miscellaneous Natural Products | | Mol File: | 17397-93-2.mol |  |
| | TanshinoneIIB Chemical Properties |
| Boiling point | 536.9±50.0 °C(Predicted) | | density | 1.282±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | powder | | pka | 14.73±0.10(Predicted) | | color | Red | | InChI | InChI=1S/C19H18O4/c1-10-8-23-18-12-5-6-13-11(4-3-7-19(13,2)9-20)15(12)17(22)16(21)14(10)18/h5-6,8,20H,3-4,7,9H2,1-2H3/t19-/m1/s1 | | InChIKey | XDUXBBDRILEIEZ-LJQANCHMSA-N | | SMILES | O1C=C(C)C2C(=O)C(=O)C3=C(C1=2)C=CC1=C3CCC[C@@]1(CO)C |
| | TanshinoneIIB Usage And Synthesis |
| Uses | Tanshinone IIB is useful in the treatment of cardiovascular diseases in clinical practice. |
| | TanshinoneIIB Preparation Products And Raw materials |
|