|
|
| | N-(2-AMINOETHYL)-2-(1-NAPHTHYL)ACETAMIDE Basic information |
| | N-(2-AMINOETHYL)-2-(1-NAPHTHYL)ACETAMIDE Chemical Properties |
| Melting point | 94-96°C | | Boiling point | 491.7±38.0 °C(Predicted) | | density | 1.147±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 14.85±0.46(Predicted) | | color | Off-White to Pale Beige | | Major Application | pharmaceutical | | InChI | 1S/C14H16N2O/c15-8-9-16-14(17)10-12-6-3-5-11-4-1-2-7-13(11)12/h1-7H,8-10,15H2,(H,16,17) | | InChIKey | OJWZEVNPRJDAME-UHFFFAOYSA-N | | SMILES | N(CCN)C(=O)Cc1c2c(ccc1)cccc2 |
| WGK Germany | WGK 3 | | HS Code | 2924296000 | | Storage Class | 13 - Non Combustible Solids |
| | N-(2-AMINOETHYL)-2-(1-NAPHTHYL)ACETAMIDE Usage And Synthesis |
| Uses | N-(2-Aminoethyl)-1-naphthylacetamide is a metabolite of Naphazoline that has been seen to be a strong collector for pyrophyllite. |
| | N-(2-AMINOETHYL)-2-(1-NAPHTHYL)ACETAMIDE Preparation Products And Raw materials |
|