|
|
| | Methyl 2-(chloromethyl)acrylate Basic information |
| Product Name: | Methyl 2-(chloromethyl)acrylate | | Synonyms: | Methyl2-(chloromethyl)acrylate;2-(Chloromethyl)acrylic acid methyl ester;Methyl 2-(chloroMethyl)acrylate, stabilised with 0.1% hydroquinone;Methyl 2-(chloroMethyl)acrylate, 97%, stabilised with 0.1% hydroquinone;Methyl 2-(chloromethyl)acrylate, Stabilized;2-Propenoic acid, 2-(chloromethyl)-, methyl ester;Methyl 2-(chloromethyl)acrylate 95%;(E)-N-Methyl-3-phenylprop-2-en-1-aMine | | CAS: | 922-15-6 | | MF: | C5H7ClO2 | | MW: | 134.56 | | EINECS: | | | Product Categories: | Building Blocks/Intermediates | | Mol File: | 922-15-6.mol |  |
| | Methyl 2-(chloromethyl)acrylate Chemical Properties |
| Boiling point | 157 °C | | density | 1.113 | | refractive index | n20/D1.455 | | Fp | 58 °C | | storage temp. | 2-8°C | | form | Liquid | | color | Clear colorless to pale yellow | | InChI | InChI=1S/C5H7ClO2/c1-4(3-6)5(7)8-2/h1,3H2,2H3 | | InChIKey | NYMDTEIPYQNXIL-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C(CCl)=C |
| Hazard Codes | Xi | | Risk Statements | 37/38-41 | | Safety Statements | 36/39 | | WGK Germany | 3 | | HS Code | 2916199590 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | Methyl 2-(chloromethyl)acrylate Usage And Synthesis |
| Chemical Properties | Methyl 2-(chloromethyl)acrylate is a colourless or light yellow transparent liquid with a density of 1.150 g/mL at 25 °C. | | Uses | Methyl 2-(chloromethyl)acrylate is a versatile reactant used in the synthesis of hydroxyl-containing dimethacrylate crosslinkers. |
| | Methyl 2-(chloromethyl)acrylate Preparation Products And Raw materials |
|