|
|
| | 2-[[(2R)-3-decanoyloxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium Basic information |
| Product Name: | 2-[[(2R)-3-decanoyloxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium | | Synonyms: | Lysolecithin, decanoyl;L-α-Lysophosphatidylcholine, decanoyl;1-DECANOYL-2-HYDROXY-SN-GLYCERO-3-PHOSPHOCHOLINE;10:0 LYSO PC;1-Decanoyllysolecithin;2-[[(2R)-3-decanoyloxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium;1-CAPRYL-2-HYDROXY-SN-GLYCERO-3-PHOSPHOCHOINE;1-Decanoyl-sn-glycero-3-phosphocholine;L-α-Lysophosphatidylcholine, decanoyl, Lysolecithin, decanoyl | | CAS: | 22248-63-1 | | MF: | C18H39NO7P | | MW: | 0 | | EINECS: | | | Product Categories: | | | Mol File: | 22248-63-1.mol | ![2-[[(2R)-3-decanoyloxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium Structure](CAS/GIF/22248-63-1.gif) |
| | 2-[[(2R)-3-decanoyloxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium Chemical Properties |
| storage temp. | −20°C | | form | powder | | InChI | 1S/C18H38NO7P/c1-5-6-7-8-9-10-11-12-18(21)24-15-17(20)16-26-27(22,23)25-14-13-19(2,3)4/h17,20H,5-16H2,1-4H3/t17-/m1/s1 | | InChIKey | SECPDKKEUKDCPG-QGZVFWFLSA-N | | SMILES | O[C@](COP([O-])(OCC[N+](C)(C)C)=O)([H])COC(CCCCCCCCC)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-[[(2R)-3-decanoyloxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium Usage And Synthesis |
| Uses | 10:0 Lyso PC has been used as an internal standard to quantify the most abundant lysophosphatidylcholine (LPC) species found in Trypanosoma cruzi samples. | | Definition | ChEBI: 1-decanoyl-sn-glycero-3-phosphocholine is a 1-O-acyl-sn-glycero-3-phosphocholine in which the acyl group is specified as capryl (decanoyl). It is a 1-O-acyl-sn-glycero-3-phosphocholine and a decanoate ester. | | Biological Activity | Lysophosphatidylcholine (LPC) alters various biological functions in different cell-types, such as endothelial cells, smooth muscle cells, monocytes, macrophages and T-cells. It is associated with atherosclerosis and inflammatory diseases. LPC activates many second messengers including, protein kinase C, extracellular-signal-regulated kinases and protein tyrosine kinases. |
| | 2-[[(2R)-3-decanoyloxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium Preparation Products And Raw materials |
|