BOLTON-HUNTER REAGENT manufacturers
- BOLTON-HUNTER REAGENT
-
- $1.00
-
2020-01-03
- CAS: 34071-95-9
- Min. Order: 1KG
- Purity: 95-99%
- Supply Ability: 1ton
|
| | BOLTON-HUNTER REAGENT Basic information |
| Product Name: | BOLTON-HUNTER REAGENT | | Synonyms: | 3-(P-HYDROXYPHENYL)PROPIONIC ACID*N-HYDR OXYSUCCINIM;3-(4-HYDROXYPHENYL)PROPIONIC ACID N-HYDROXYSUCCINIMIDE ESTER, TECH., 90%;3-(4-HYDROXYPHENYL)PROPIONIC ACID N-HYDR OXYSUCCINIMIDE ESTE;3-(4-Hydroxyphenyl)propionic acid N-hydroxysuccinimide ester, 99+%;3-(4-hydroxyphenyl)propionic acid N-hydroxysuccinimide est;N-[(4-Hydroxyhydrocinnamoyl)oxy]succinimide, N-Succinimidyl 3-(4-hydroxyphenyl)propionate, Bolton-Hunter reagent precursor, Rudinger reagent, SHPP;3-(4'-Hydroxyphenyl)propionic Acid N-Hydroxysuccinimide;Rudinger reagent, Bolton-Hunter reagent | | CAS: | 34071-95-9 | | MF: | C13H13NO5 | | MW: | 263.25 | | EINECS: | 251-818-1 | | Product Categories: | Aromatic Propionic Acids;iodination | | Mol File: | 34071-95-9.mol |  |
| | BOLTON-HUNTER REAGENT Chemical Properties |
| Melting point | 132-133 °C(lit.) | | Boiling point | 406.49°C (rough estimate) | | density | 1.2705 (rough estimate) | | refractive index | 1.5480 (estimate) | | storage temp. | -20°C | | solubility | Acetonitrile (Slightly), Chloroform (Slightly), DMSO (Slightly) | | form | Solid | | pka | 9.93±0.15(Predicted) | | color | White to Light Orange | | Water Solubility | Soluble in water. | | BRN | 1545011 | | Major Application | peptide synthesis | | InChI | 1S/C13H13NO5/c15-10-4-1-9(2-5-10)3-8-13(18)19-14-11(16)6-7-12(14)17/h1-2,4-5,15H,3,6-8H2 | | InChIKey | KYRUKRFVOACELK-UHFFFAOYSA-N | | SMILES | Oc1ccc(CCC(=O)ON2C(=O)CCC2=O)cc1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 2928009090 | | Storage Class | 11 - Combustible Solids |
| | BOLTON-HUNTER REAGENT Usage And Synthesis |
| Chemical Properties | white to off-white powder | | Uses | Bolton-Hunter Reagent is used for iodination of proteins that do not contain tyrosine residues, Bolton-Hunter reagent precursor (3-(4-Hydroxyphenyl)propionic acid N-hydroxysuccinimide ester) is a hydroxysuccinimide ester used as an intermediate for high radioactive radioiodination of proteins. | | Uses | 3-(4-Hydroxyphenyl)propionic acidN-hydroxysuccinimide ester can be used to prepare 125I-labeled reagents, which are used in binding assay studies of proteins and peptides. | | reaction suitability | reagent type: linker |
| | BOLTON-HUNTER REAGENT Preparation Products And Raw materials |
|