| Company Name: |
BioBioPha Co., Ltd.
|
| Tel: |
0871-65217109 |
| Email: |
y.liu@mail.biobiopha.com |
| Products Intro: |
Product Name:Rutarin
CAS:20320-81-4
Purity:98% HPLC ，BBP05709 Package:5mg; 10mg; 20mg; 1g，克級(jí)別可定制
|
| Company Name: |
Shanghai Binsui Biotechnology Co., Ltd.
|
| Tel: |
18301908279 18301908279; |
| Email: |
1292752157@qq.com |
| Products Intro: |
Product Name:Rutarin
CAS:20320-81-4
Purity:98.0% Package:5mg;10mg;20mg;100mg;1g
|
RUTARIN manufacturers
- RUTARIN
-
- $20.00
-
2023-03-27
- CAS:20320-81-4
- Min. Order: 1KG
- Purity: 99.9%
- Supply Ability: 500MT/month
|
| | RUTARIN Basic information |
| Product Name: | RUTARIN | | Synonyms: | RUTARIN;7H-Furo[3,2-g][1]benzopyran-7-one, 9-(β-D-glucopyranosyloxy)-2,3-dihydro-2-(1-hydroxy-1-methylethyl)- | | CAS: | 20320-81-4 | | MF: | C20H24O10 | | MW: | 424.4 | | EINECS: | | | Product Categories: | | | Mol File: | 20320-81-4.mol |  |
| | RUTARIN Chemical Properties |
| Boiling point | 726.5±60.0 °C(Predicted) | | density | 1.562±0.06 g/cm3(Predicted) | | form | Solid | | pka | 12.71±0.70(Predicted) | | color | White to off-white | | InChIKey | JWWFVRMFYKPZNE-BLALXGCGNA-N | | SMILES | C1(=O)OC2=C(C=C3C[C@@H](C(O)(C)C)OC3=C2OC2[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O2)C=C1 |&1:8,18,20,22,24,r| |
| | RUTARIN Usage And Synthesis |
| Uses | Rutarin is a Coumarin (HY-N0709) derivative, that can be isolated from the aerial parts of the plant Atalantta racemosa[1]. | | Definition | ChEBI: A natural product found in Citropsis articulata. | | References | [1] Banerji A, et al. Prenylated compounds from Atalantia racemosa: isolation and synthesis of two pyranoflavones. Phytochemistry, 1988, 27(11):3637-3640. |
| | RUTARIN Preparation Products And Raw materials |
|