| Company Name: |
Zhangjiagang Xinya Chemical Co., Ltd. Gold
|
| Tel: |
0512-58980899 13915696858 |
| Email: |
sales@zjgxinyachem.com |
| Products Intro: |
Product Name:TIAP
CAS:919-62-0
Purity:98 Package:180KG
|
| Company Name: |
Suzhou Chenke Biotech Co., Ltd.
|
| Tel: |
18662408853 18662408853; |
| Email: |
2120408911@qq.com |
| Products Intro: |
Product Name:tri(3-methyl-1-butyl) phosphate
CAS:919-62-0
Purity:98% Package:1G;10G;100G;1KG;10KG;100KG
|
| Company Name: |
ZHEJIANG ZETIAN FINE CHEMICALS CO.,LTD
|
| Tel: |
18957127338 18305707819; |
| Email: |
sales@zetchem.com |
| Products Intro: |
Product Name:TIAP
CAS:919-62-0
Purity:99% Package:5g;10g;100g;500g;1kg;10kg;100kg或按客戶要求
|
|
| | 1-BUTANOL,3-METHYL-,PHOSPHATE Basic information | | Uses |
| Product Name: | 1-BUTANOL,3-METHYL-,PHOSPHATE | | Synonyms: | 1-BUTANOL,3-METHYL-,PHOSPHATE;Phosphoric acid triisoamyl ester;Phosphoric acid tris(3-methylbutyl) ester;tri(3-methyl-1-butyl) phosphate;1-Butanol, 3-methyl-, 1,1',1''-phosphate;Triisopentylphosphat;triisoamyl phosphate;Triisopentylphosphate | | CAS: | 919-62-0 | | MF: | C15H33O4P | | MW: | 308.39 | | EINECS: | | | Product Categories: | | | Mol File: | 919-62-0.mol |  |
| | 1-BUTANOL,3-METHYL-,PHOSPHATE Chemical Properties |
| Boiling point | 297.7±8.0 °C(Predicted) | | density | 0.962±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C15H33O4P/c1-13(2)7-10-17-20(16,18-11-8-14(3)4)19-12-9-15(5)6/h13-15H,7-12H2,1-6H3 | | InChIKey | YQLIHRFKJJQBAF-UHFFFAOYSA-N | | SMILES | P(OCCC(C)C)(OCCC(C)C)(OCCC(C)C)=O | | EPA Substance Registry System | 1-Butanol, 3-methyl-, phosphate (3:1) (919-62-0) |
| | 1-BUTANOL,3-METHYL-,PHOSPHATE Usage And Synthesis |
| Uses | Triisoamyl phosphate (TiAP) is considered an excellent extractant for the extraction and separation of actinide elements due to its superior physicochemical properties, and is particularly suitable for systems with high irradiation doses and systems with high relative plutonium concentrations. | | Purification Methods | Purify the ester by repeated crystallisation, from hexane, of its addition compound with uranyl nitrate. Decompose the complex, and distil the ester at high vacuum. [Siddall J Am Chem Soc 81 4176 1959.] [see tributyl phosphate and Cherbuliez in Organo Phosphorus Compounds (Kosolapoff & Maier eds) Wiley Vol 6 pp 211-577 1973.] |
| | 1-BUTANOL,3-METHYL-,PHOSPHATE Preparation Products And Raw materials |
|