|
|
| | 4,4',4''-Tris(N-3-methylphenyl-N-phenylamino)triphenylamine Basic information | | Applications |
| Product Name: | 4,4',4''-Tris(N-3-methylphenyl-N-phenylamino)triphenylamine | | Synonyms: | 4,4',4''-TRIS(N-3-METHYLPHENYL-N-PHENYL-AMINO)-TRIPHENYLAMINE;4,4',4'-TRIS(N-3-METHYLPHENYL-N-PHENYL-AMINO)-TRIPHENYLAMINE M-MTDATA;SUBLI;4,4',4''-Tris(N-3-me;M-MTDATA,4,4',4''-Tris(N-3-Methylphenyl-N-phenylaMino)triphenyla;4,4',4''-Tris[phenyl(M-tolyl)aMino]triphenylaMine;N1-Phenyl-N4,N4-bis(4-(phenyl(M-tolyl)aMino)phenyl)-N1-(M-tolyl)benzene-1,4-diaMine;4,4',4''-Tris[phenyl(3-Methylphenyl)aMino]triphenylaMine, 98% | | CAS: | 124729-98-2 | | MF: | C57H48N4 | | MW: | 789.02 | | EINECS: | 631-370-7 | | Product Categories: | OLED;oled materials;electronic;OLED-sublimed | | Mol File: | 124729-98-2.mol |  |
| | 4,4',4''-Tris(N-3-methylphenyl-N-phenylamino)triphenylamine Chemical Properties |
| Melting point | 203-207°C | | density | 1.190±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | -1.07±0.60(Predicted) | | form | powder | | color | White to Yellow | | InChIKey | DIVZFUBWFAOMCW-UHFFFAOYSA-N | | SMILES | C1(N(C2=CC=CC(C)=C2)C2=CC=CC=C2)=CC=C(N(C2=CC=C(N(C3=CC=CC(C)=C3)C3=CC=CC=C3)C=C2)C2=CC=C(N(C3=CC=CC(C)=C3)C3=CC=CC=C3)C=C2)C=C1 | | Absorption | λmax312 nm, 342 nm in THF |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29214200 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4,4',4''-Tris(N-3-methylphenyl-N-phenylamino)triphenylamine Usage And Synthesis |
| Applications | With its very low solid-state ionisation potential and good-quality amorphous film, 4,4',4''-Tris[phenyl(m-tolyl)amino]triphenylamine, m-MTDATA acts as an effective material for the hole-injection buffer layer (HIL) that facilitates hole injection from the ITO electrode to the hole transporting layer (HTL). This potentially lowers the driving voltage of the OLED devices. F4-TCNQ, a strong electron acceptor, is always used together with m-MTDATA as a p-doping material to improve the conductivity of the HTL buffering layer. Typical structure of the device (or part of the device) is ITO/p-doped m-MTDATA/HTL/etc.
| | Description | With its very low solid-state ionisation potential and good-quality amorphous film, 4,4',4''-Tris[phenyl(m-tolyl)amino]triphenylamine, m-MTDATA acts as an effective material for the hole-injection buffer layer (HIL) that facilitates hole injection from the ITO electrode to the hole transporting layer (HTL). This potentially lowers the driving voltage of the OLED devices. | | Uses | Hole-transporting layer and Hole Injection layer material for High-Performance OLEDs. |
| | 4,4',4''-Tris(N-3-methylphenyl-N-phenylamino)triphenylamine Preparation Products And Raw materials |
|