| Company Name: |
SREE SYNERIC LAB
|
| Tel: |
+91-91-6383636810 +91-9884742764 |
| Email: |
synericlab@gmail.com |
| Products Intro: |
Product Name:2,2'-Dichlorobenzilic acid-98% CAS:3152-12-3 Purity:99% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
|
| | 2,2'-DICHLOROBENZILIC ACID Basic information |
| | 2,2'-DICHLOROBENZILIC ACID Chemical Properties |
| Melting point | 160-164 °C (lit.) | | Boiling point | 480.6±40.0 °C(Predicted) | | density | 1.469±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 2.95±0.10(Predicted) | | form | solid | | Appearance | White to off-white Solid | | BRN | 2387319 | | InChI | 1S/C14H10Cl2O3/c15-11-7-3-1-5-9(11)14(19,13(17)18)10-6-2-4-8-12(10)16/h1-8,19H,(H,17,18) | | InChIKey | OJYHUFNZIWRMPT-UHFFFAOYSA-N | | SMILES | OC(=O)C(O)(c1ccccc1Cl)c2ccccc2Cl |
| Hazard Codes | Xi,N | | Risk Statements | 36/37/38-50/53 | | Safety Statements | 26-36-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,2'-DICHLOROBENZILIC ACID Usage And Synthesis |
| Uses | 2,2-Bis(2-chlorophenyl)-2-hydroxyacetic Acid is a useful intermediate in the synthesis of substituted benzilic acid derivatives with antimicrobial properties. |
| | 2,2'-DICHLOROBENZILIC ACID Preparation Products And Raw materials |
|