|
|
| | 3-Amino-5-nitroindazole Basic information |
| Product Name: | 3-Amino-5-nitroindazole | | Synonyms: | 3-Amino-5-nitro-1H-indazole;1H-indazol-3-amine, 5-nitro-;5-nitroindazol-3-aMine;5-Nitro-1H-indazol-3-ylaMine;3-AMINO-5-NITROINDAZOLE;1H-Indazole, 3-amino-5-nitro-;1H-Benzimidazole,2-(4-methoxyethyl)-;5-NITRO-1H-INDAZOL-3-AMINE | | CAS: | 41339-17-7 | | MF: | C7H6N4O2 | | MW: | 178.15 | | EINECS: | | | Product Categories: | Indoles and derivatives | | Mol File: | 41339-17-7.mol |  |
| | 3-Amino-5-nitroindazole Chemical Properties |
| Melting point | 254-256°C | | Boiling point | 485.2±25.0 °C(Predicted) | | density | 1.631±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 12.60±0.40(Predicted) | | Appearance | Light brown to orange Solid | | InChI | InChI=1S/C7H6N4O2/c8-7-5-3-4(11(12)13)1-2-6(5)9-10-7/h1-3H,(H3,8,9,10) | | InChIKey | SWZRTDLKPZAFDT-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C([N+]([O-])=O)C=C2)C(N)=N1 | | CAS DataBase Reference | 41339-17-7(CAS DataBase Reference) |
| | 3-Amino-5-nitroindazole Usage And Synthesis |
| Synthesis | General procedure for the synthesis of 3-amino-5-nitroindazole from 2-fluoro-5-nitrobenzonitrile: 2-fluoro-5-nitrobenzonitrile (1.0 g, 6.02 mmol) was dissolved in n-butanol (20 mL). Subsequently, hydrazine hydrate (420 μL, 7.22 mmol) was added to this solution. The reaction mixture was stirred at 110 °C for 2 h and then cooled to room temperature. Dichloromethane (MC) was added to the reaction mixture and the precipitate precipitated was filtered to afford the target compound in 84% yield. The product was characterized by 1H NMR (400 MHz, DMSO-d6): δ 8.89 (d, 1H), 8.05 (dd, 1H), 7.34 (d, 2H), 5.98 (s, 2H). The molecular weight was measured as 178.15 by mass spectrometry. | | References | [1] Patent: US2017/158642, 2017, A1. Location in patent: Paragraph 0075; 0076
[2] Bioorganic and Medicinal Chemistry Letters, 2005, vol. 15, # 23, p. 5293 - 5297
[3] Patent: US2004/9968, 2004, A1
[4] Bioorganic and Medicinal Chemistry Letters, 2011, vol. 21, # 1, p. 550 - 554
[5] Patent: WO2013/55984, 2013, A1. Location in patent: Paragraph 00342 |
| | 3-Amino-5-nitroindazole Preparation Products And Raw materials |
|