|
|
| | 2-(Aminomethyl)-1-Boc-piperidine Basic information |
| | 2-(Aminomethyl)-1-Boc-piperidine Chemical Properties |
| Boiling point | 299.4±13.0 °C(Predicted) | | density | 1.0124 g/mL at 25 °C | | refractive index | n20/D 1.4745 | | Fp | 110 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Soluble in DMSO. | | form | liquid | | pka | 10.32±0.29(Predicted) | | Appearance | Colorless to light yellow Liquid | | Optical Rotation | -0.1°(C=0.01 g/ml CHCL3) | | InChI | InChI=1S/C11H22N2O2/c1-11(2,3)15-10(14)13-7-5-4-6-9(13)8-12/h9H,4-8,12H2,1-3H3 | | InChIKey | PTVRCUVHYMGECC-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCCCC1CN | | CAS DataBase Reference | 370069-31-1(CAS DataBase Reference) |
| Hazard Codes | Xn,N | | Risk Statements | 22-36/37/38-50 | | Safety Statements | 26-61 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 3 | | HazardClass | 9 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-(Aminomethyl)-1-Boc-piperidine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Reactant for synthesis of:
TRPV1 antagonists
CHK1 inhibitors
p38a MAP kinase inhibitors
Carbamoylphosphonates
Macrolactams via carbonylation/intramolecular amidation
Intramolecular transamidation | | Reactions | 2-(Aminomethyl)-1-Boc-piperidine, also known as Tert-butyl 2-(aminomethyl)piperidine-1-carboxylate, is an important organic reagent that can be used as a building block for the synthesis of many organic compounds, such as tert-butyl 2 - ((2, 6 - dimethyl-phenyl amide) methyl) piperidine -1 - carboxylic esters which can be used for preparing medicines in the fields of local anaesthesia or analgesia.
 |
| | 2-(Aminomethyl)-1-Boc-piperidine Preparation Products And Raw materials |
|