| Company Name: |
Henan Tianfu Chemical Co.,Ltd. |
| Tel: |
+86-0371-55170693 +86-19937530512 |
| Email: |
info@tianfuchem.com |
| Products Intro: |
Product Name:Platinum,[2,3,7,8,12,13,17,18-octaethyl-21H,23H-porphinato(2-)-kN21,kN22,kN23,kN24]-, (SP-4-1)-
CAS:31248-39-2
Purity:99% Package:25KG;5KG;1KG
|
|
|
|
|
- PtOEP
-
-
2026-05-19
- CAS:31248-39-2
- Min. Order: 1g
- Purity: 99.3%
- Supply Ability: 100kgs
|
| Product Name: | PTOEP | | Synonyms: | PtOEP, Platinum(II) 2,3,7,8,12,13,17,18-octaethyl-21H,23H-porphyrin;Platinum octaethylporphyrin,Platinum(II) 2,3,7,8,12,13,17,18-octaethyl-21H,23H-porphyrin, PtOEP;PtOEP , Pt(II) octaethylporphine;Platinum 2,3,7,8,12,13,17,18-octaethyl-21H,23H-porphine;2,3,7,8,12,13,17,18-Octaethylporphyrin platinuM(II);PlatinuM octaethylporphyrin Dye content 98 %;2,3,7,8,12,13,17,18-octaethyl-1,4,5,10,11,14,15,20,21,23-decahydroporphyrin-22,24-diide,platinum(2+);Platinum(II) octaethylporphine | | CAS: | 31248-39-2 | | MF: | C36H44N4Pt | | MW: | 727.84 | | EINECS: | | | Product Categories: | Porphyrins;Synthetic Porphyrins | | Mol File: | 31248-39-2.mol |  |
| | PTOEP Chemical Properties |
| Melting point | >300 °C | | form | solid | | color | red | | λmax | 649 nm (PL) | | InChIKey | WAODGUVBNLMTSF-XTPDIVBZSA-N | | SMILES | CCc1c(CC)c2cc3c(CC)c(CC)c4cc5nc(cc6c(CC)c(CC)c(cc1n2)n6[Pt]n34)c(CC)c5CC |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | PTOEP Usage And Synthesis |
| Uses | Platinum octaethylporphyrin (PtOEP) may be used as a fluorescent dye in the fabrication of polymer- and silica-based oxygen sensors. It is used as a red triplet emitting material with high external quantum yields for OLEDs. PtOEP is used as a dopant in host materials like CBP and Alq3. Its red emission is near 650 nm depending on host material and processing conditions. | | General Description | PtOEP is an oxygen-quenchable luminescent dye. |
| | PTOEP Preparation Products And Raw materials |
|