|
|
| | 2-Chloro-3-nitropyridine Basic information |
| | 2-Chloro-3-nitropyridine Chemical Properties |
| Melting point | 100-103 °C (lit.) | | Boiling point | 260.3±20.0 °C(Predicted) | | density | 1.6616 (rough estimate) | | refractive index | 1.454-1.456 | | Fp | 185°C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | Water Solubility | Insoluble in water | | form | Crystalline Powder | | pka | -2.60±0.10(Predicted) | | color | Yellow | | BRN | 124482 | | InChI | InChI=1S/C5H3ClN2O2/c6-5-4(8(9)10)2-1-3-7-5/h1-3H | | InChIKey | UUOLETYDNTVQDY-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=CC=C1[N+]([O-])=O | | CAS DataBase Reference | 5470-18-8(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Chloro-3-nitropyridine(5470-18-8) | | EPA Substance Registry System | Pyridine, 2-chloro-3-nitro- (5470-18-8) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/22-36/37/38-22 | | Safety Statements | 22-24/25-37/39-26-36 | | RIDADR | UN 2811 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | HS Code | 29333999 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Chloro-3-nitropyridine Usage And Synthesis |
| Chemical Properties | yellow crystalline powder | | Uses | 2-Chloro-3-nitropyridine is often used as a pharmaceutical intermediate.
| | Reactions | 2-Chloro-3-nitropyridine is a nucleophilic compound that reacts with amines to form substituted amines.
| | Synthesis | General procedure for the synthesis of 2-chloro-3-nitropyridine from 3-nitropyridine-2-carboxylic acid: accurately weigh 3-nitropyridine-2-carboxylic acid (50.4 mg, 0.3 mmol), sodium carbonate (64.0 mg, 0.6 mmol), sodium chloride (17.6 mg, 0.3 mmol) and tert-butyl hypochlorite (32 μL, 0.3 mmol) in a 25 mL Schlenk reaction flask. Subsequently, dichloromethane (3 mL) was added as a solvent and the reaction mixture was placed in an oil bath at 25 °C for 20 hours. After completion of the reaction, the solvent was removed by distillation under reduced pressure. The crude product was purified by silica gel column chromatography using petroleum ether/ethyl acetate as eluent to give 2-chloro-3-nitropyridine in 58% yield. | | Purification Methods | It forms needles from H2O. Purify it by continuous sublimation over a period of 2 weeks at 50-60o/0.1mm [Barlin J Chem Soc 2150 1964]. The N-oxide has m 100o(from CH2Cl2/Et2O). [Taylor & Driscoll J Org Chem 25 1716 1960, Ochiai & Kaneko Chem Pharm Bull Jpn 8 28 1960, Beilstein 20/5 V 451.] | | References | [1] Patent: CN108586334, 2018, A. Location in patent: Paragraph 0060-0062 |
| | 2-Chloro-3-nitropyridine Preparation Products And Raw materials |
|