| Company Name: |
TianJin Alta Scientific Co., Ltd.
|
| Tel: |
022-65378550-8551 |
| Email: |
contact@altascientific.com |
| Products Intro: |
Product Name:Fluazifop (free acid)
CAS:69335-91-7
Purity:98% Package:10Mg 25Mg 100Mg
|
| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Fluazifop (free acid)
CAS:69335-91-7
Purity:99% Package:10mg
|
|
| | FLUAZIFOP Basic information |
| | FLUAZIFOP Chemical Properties |
| Melting point | 97-100 °C | | Boiling point | 429.9±45.0 °C(Predicted) | | density | 1.370±0.06 g/cm3(Predicted) | | Fp | -4 °C | | storage temp. | APPROX 4°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 3.17±0.10(Predicted) | | BRN | 552236 | | Henry's Law Constant | 3.4×107 mol/(m3Pa) at 25℃, Ebert et al. (2023) | | Major Application | agriculture
environmental | | InChI | 1S/C15H12F3NO4/c1-9(14(20)21)22-11-3-5-12(6-4-11)23-13-7-2-10(8-19-13)15(16,17)18/h2-9H,1H3,(H,20,21) | | InChIKey | YUVKUEAFAVKILW-UHFFFAOYSA-N | | SMILES | CC(Oc1ccc(Oc2ccc(cn2)C(F)(F)F)cc1)C(O)=O |
| | FLUAZIFOP Usage And Synthesis |
| Uses | (┬)-Fluazifop is a grass-selective herbicide which inhibits acetyl-CoA carboxylase in sensitive plant species. | | Definition | ChEBI: 2-(4-{[5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid is a monocarboxylic acid that is propanoic acid substituted by a 4-{[5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy group at position 2. It is an aromatic ether, a monocarboxylic acid, an organofluorine compound and a member of pyridines. |
| | FLUAZIFOP Preparation Products And Raw materials |
|