|
|
| | 1,3-diisopropyl-2-isothiocyanato-5-phenoxybenzene Basic information |
| Product Name: | 1,3-diisopropyl-2-isothiocyanato-5-phenoxybenzene | | Synonyms: | 1,3-diisopropyl-2-isothiocyanato-5-phenoxybenzene;2-Isothiocyanato-1,3-bis(1-methylethyl)-5-phenoxybenzene;Benzene, 2-isothiocyanato-1,3-bis(1-methylethyl)-5-phenoxy-;2,6-Diisopropyl-4-phenoxy phenyl thiocyanate;N-(2,6-diisopropyl-4-phenoxyphenyl)isothiocyanate;4-phenoxy-2，6-diisopropyl phenyl isothiocyanate;DIPPI | | CAS: | 80058-93-1 | | MF: | C19H21NOS | | MW: | 311.44 | | EINECS: | | | Product Categories: | intermediate | | Mol File: | 80058-93-1.mol |  |
| | 1,3-diisopropyl-2-isothiocyanato-5-phenoxybenzene Chemical Properties |
| Boiling point | 411.0±45.0 °C(Predicted) | | density | 1.04±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Dichloromethane; Ethyl Acetate; Methanol | | form | Solid | | color | Light Yellow | | InChI | InChI=1S/C19H21NOS/c1-13(2)17-10-16(21-15-8-6-5-7-9-15)11-18(14(3)4)19(17)20-12-22/h5-11,13-14H,1-4H3 | | InChIKey | ZZNJNNXQRSAGSP-UHFFFAOYSA-N | | SMILES | C1(C(C)C)=CC(OC2=CC=CC=C2)=CC(C(C)C)=C1N=C=S |
| | 1,3-diisopropyl-2-isothiocyanato-5-phenoxybenzene Usage And Synthesis |
| Chemical Properties | It is light yellow oily viscous liquid, b.p. 130~140℃/5Pa, decomposed in water, soluble in xylene, trimethylbenzene and other solvents. | | Uses | 2-Isothiocyanato-1,3-bis(1-methylethyl)-5-phenoxybenzene is a proposed intermediate in the synthesis of 6-Amino-1-(2,6-diisopropyl-4-phenoxyphenyl)-4-((2,6-diisopropyl-4-phenoxyphenyl)amino)-1,3,5-triazine-2(1H)-thione (A607450) is an impurity compound of Diafenthiuron (D310550), an insecticide. |
| | 1,3-diisopropyl-2-isothiocyanato-5-phenoxybenzene Preparation Products And Raw materials |
|