|
|
| | 6-Fluoro-4-(trifluoromethyl)-2(1H)-quinolinone Basic information |
| Product Name: | 6-Fluoro-4-(trifluoromethyl)-2(1H)-quinolinone | | Synonyms: | 6-Fluoro-4-(trifluoromethyl)-2(1H)-quinolinone;6-Fluoro-4-(trifluoromethyl)quinolin-2-ol;6-Fluoro-4-(trifluoromethyl)quinolin-2-ol ,97%;6-Fluoro-2-hydroxy-4-(trifluoroMethyl)quinoline, 97%;6-Fluoro-4-(trifluoroMethyl)quinolin-2(1H)-one;6-fluoro-4-(trifluoromethyl)-1H-quinolin-2-one;2(1H)-Quinolinone, 6-fluoro-4-(trifluoromethyl)- | | CAS: | 328956-08-7 | | MF: | C10H5F4NO | | MW: | 231.15 | | EINECS: | | | Product Categories: | | | Mol File: | 328956-08-7.mol |  |
| | 6-Fluoro-4-(trifluoromethyl)-2(1H)-quinolinone Chemical Properties |
| Melting point | 252-253 °C (decomp)(Solv: ethanol (64-17-5)) | | Boiling point | 282 ºC | | density | 1.468 | | Fp | 124 ºC | | storage temp. | 2-8°C | | pka | 9.33±0.70(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H5F4NO/c11-5-1-2-8-6(3-5)7(10(12,13)14)4-9(16)15-8/h1-4H,(H,15,16) | | InChIKey | WUFRBOSKPZUGIS-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(F)C=C2)C(C(F)(F)F)=CC1=O |
| | 6-Fluoro-4-(trifluoromethyl)-2(1H)-quinolinone Usage And Synthesis |
| Chemical Properties | White solid | | Description | As a quinoline derivative, 6-Fluoro-4-hydroxy-2-(trifluoromethyl)quinoline is substituted with trifluoromethyl, hydroxyl, and fluoride groups. In particular, 6-Fluoro-4-hydroxy-2-(trifluoromethyl)quinoline can exist in a tautomeric form, known as quinolone, where the hydroxy group becomes a ketone and the imine changes to an amine. This compound is a precursor for synthesizing thioquinolines, which are used to develop non-cytotoxic, potent and selective antitubercular agents. The thiolation reaction is carried out using phosphorus pentasulfide in pyridine. |
| | 6-Fluoro-4-(trifluoromethyl)-2(1H)-quinolinone Preparation Products And Raw materials |
|