|
|
| | MALONIC-D2 ACID-D2 Basic information |
| | MALONIC-D2 ACID-D2 Chemical Properties |
| Melting point | 132-135 °C (dec.) (lit.) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | DMSO, Metahnol | | form | Solid | | color | White | | Stability: | Moisture Sensitive | | InChI | 1S/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/i1D2/hD2 | | InChIKey | OFOBLEOULBTSOW-BGOGGDMHSA-N | | SMILES | [2H]OC(=O)C([2H])([2H])C(=O)O[2H] | | CAS Number Unlabeled | 141-82-2 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HS Code | 28459000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | MALONIC-D2 ACID-D2 Usage And Synthesis |
| Chemical Properties | fine powder | | Uses | Malonic Acid-d4 is the isotope labelled analog of Malonic Acid (M158005); a small bioactive molecule that can be used in various reactions. It is the classic example of a competitive inhibitor which acts against succinate dehydrogenase (complex II) in the respiratory electron transport chain. |
| | MALONIC-D2 ACID-D2 Preparation Products And Raw materials |
|