| Company Name: |
BeiJing Hwrk Chemicals Limted
|
| Tel: |
0757-86329057 18934348241 |
| Email: |
sales4.gd@hwrkchemical.com |
| Products Intro: |
Product Name:C-METHYLCALIX[4]RESORCINARENE CAS:65338-98-9 Purity:95.00% Package:1g
|
|
| | C-METHYLCALIX[4]RESORCINARENE Basic information |
| Product Name: | C-METHYLCALIX[4]RESORCINARENE | | Synonyms: | C-METHYLCALIX[4]RESORCINARENE;TETRAMETHYLCALIX[4]RESORCINOLARENE;4-(1-(2,4-dihydroxy-5-isopropylphenyl)ethyl)-6-(1-(5-(1-(2,4-dihydroxyphenyl)propan-2-yl)-2,4-dihydroxyphenyl)ethyl)benzene-1,3-diol;2,8,14,20-Tetramethylcalix[4]resorcinarene;r-2,c-8,c-14,c-20-tetramethylpentacyclo<19.3.1.13,7.1.9,13.115,19>octacosa-1(25),3,5,7(28),9,11,13(27),15,17,19(26),21,23-dedecaen-4,6,10,12,16,18,22,24-octol;Pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9,11,13(27),15,17,19(26),21,23-dodecaene-4,6,10,12,16,18,22,24-octol, 2,8,14,20-tetramethyl-;2,4,6,8-Tetramethyl-1,3,5,7(1,3)-tetrabenzenacyclooctaphan-1(4),1(6),3(4),3(6),5(4),5(6),7(4),7(6)-octaol;C-Methylcalix[4]resorcinarene | | CAS: | 65338-98-9 | | MF: | C32H32O8 | | MW: | 544.59 | | EINECS: | | | Product Categories: | Calixarenes;Chelation/Complexation Compounds;Synthetic Reagents | | Mol File: | 65338-98-9.mol | ![C-METHYLCALIX[4]RESORCINARENE Structure](CAS/GIF/65338-98-9.gif) |
| | C-METHYLCALIX[4]RESORCINARENE Chemical Properties |
| Melting point | >300 °C(lit.) | | Boiling point | 853.7±60.0 °C(Predicted) | | density | 1.363±0.06 g/cm3(Predicted) | | pka | 9.16±0.70(Predicted) | | form | powder | | BRN | 9110521 | | InChI | 1S/C32H32O8/c1-13-17-5-19(27(35)9-25(17)33)14(2)21-7-23(31(39)11-29(21)37)16(4)24-8-22(30(38)12-32(24)40)15(3)20-6-18(13)26(34)10-28(20)36/h5-16,33-40H,1-4H3 | | InChIKey | WGDNYTQTRISCMM-UHFFFAOYSA-N | | SMILES | [H]C1(C)c2cc(c(O)cc2O)C([H])(C)c3cc(c(O)cc3O)C([H])(C)c4cc(c(O)cc4O)C([H])(C)c5cc1c(O)cc5O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 3-8-10 | | Storage Class | 11 - Combustible Solids |
| | C-METHYLCALIX[4]RESORCINARENE Usage And Synthesis |
| Uses | Reactant involved in:
- Synthesis of selective receptors for aqueous mercury(II) and complexation with copper(II) and silver(I)
- Synthesis of nonchemically amplified molecular resists used as a dissolution promotor
- Reactions with glycidyl Ph ether used for thermal curing of epoxy resin
- Mannich reactions
- Mediation of prenucleation and coalescence of cobalt nanoclusters
- Atom transfer radical polymerization for synthesis of a star polymer
|
| | C-METHYLCALIX[4]RESORCINARENE Preparation Products And Raw materials |
|