| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:2-piperazin-1-yl-1,3-benzoxazole(SALTDATA: FREE)
CAS:111628-39-8
Purity:95% Package:1G, 5G, 10G
|
| Company Name: |
Beijing Ouhe Technology Co., Ltd
|
| Tel: |
13552068683 13522913783 |
| Email: |
2355560935@qq.com |
| Products Intro: |
Product Name:2-(Piperazin-1-yl)benzo[d]oxazole
CAS:111628-39-8
Purity:98% Package:100mg
|
|
| | 2-PIPERAZIN-1-YL-BENZOOXAZOLE Basic information |
| Product Name: | 2-PIPERAZIN-1-YL-BENZOOXAZOLE | | Synonyms: | 2-PIPERAZINO-1,3-BENZOXAZOLE;2-PIPERAZIN-1-YL-BENZOOXAZOLE;BUTTPARK 120\07-01;CHEMBRDG-BB 4102378;2-(piperazin-1-yl)benzo[d]oxazole;2-piperazin-1-yl-1,3-benzoxazole(SALTDATA: FREE);2-piperazin-1-yl-1,3-benzoxazole;Benzoxazole, 2-(1-piperazinyl)- | | CAS: | 111628-39-8 | | MF: | C11H13N3O | | MW: | 203.24 | | EINECS: | | | Product Categories: | | | Mol File: | 111628-39-8.mol |  |
| | 2-PIPERAZIN-1-YL-BENZOOXAZOLE Chemical Properties |
| Melting point | 68-70 °C | | Boiling point | 345.1±52.0 °C(Predicted) | | density | 1.210±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | solid | | pka | 8.55±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C11H13N3O/c1-2-4-10-9(3-1)13-11(15-10)14-7-5-12-6-8-14/h1-4,12H,5-8H2 | | InChIKey | HLKHIJZYKGDCJM-UHFFFAOYSA-N | | SMILES | C12=C(N=C(N3CCNCC3)O2)C=CC=C1 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-PIPERAZIN-1-YL-BENZOOXAZOLE Usage And Synthesis |
| Synthesis Reference(s) | Journal of Medicinal Chemistry, 41, p. 3015, 1998 DOI: 10.1021/jm9801004 |
| | 2-PIPERAZIN-1-YL-BENZOOXAZOLE Preparation Products And Raw materials |
|