|
|
| | 2-(Trifluoromethoxy)benzoic acid Basic information |
| | 2-(Trifluoromethoxy)benzoic acid Chemical Properties |
| Melting point | 78 °C | | Boiling point | 231.6±35.0 °C(Predicted) | | density | 1.447±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 2.89±0.36(Predicted) | | color | White to Almost white | | BRN | 2645481 | | InChI | InChI=1S/C8H5F3O3/c9-8(10,11)14-6-4-2-1-3-5(6)7(12)13/h1-4H,(H,12,13) | | InChIKey | JMYSPFGUBNENSE-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC=C1OC(F)(F)F | | CAS DataBase Reference | 1979-29-9(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 2-(Trifluoromethoxy)benzoic acid Usage And Synthesis |
| Chemical Properties | Off-white powder | | Definition | ChEBI: 2-(Trifluoromethoxy)benzoic acid is a member of benzoic acids. |
| | 2-(Trifluoromethoxy)benzoic acid Preparation Products And Raw materials |
|