|
|
| | 3,6-Di(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione Basic information |
| Product Name: | 3,6-Di(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione | | Synonyms: | 3,6-Dithiophen-2-yl-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione;2,5-Dihydro-3,6-di-2-thienyl-pyrrolo[3,4-c]pyrrole-1,4-dione;2,5-Dihydro-3,6-di-2-thienyl-pyrrolo[3,4-c]pyrrole-1,4-dione 97%;3,6-Di(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione;3,6-Di(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione;Pyrrolo[3,4-c]pyrrole-1,4-dione, 2,5-dihydro-3,6-di-2-thienyl-;850583-75-4 3,6-Di(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione;3,6-Di(thiophen-2-yl)pyrrolo[3,4-c]pyrrole-2,5-dihydro-1,4-dione | | CAS: | 850583-75-4 | | MF: | C14H8N2O2S2 | | MW: | 300.36 | | EINECS: | | | Product Categories: | | | Mol File: | 850583-75-4.mol | ![3,6-Di(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione Structure](CAS2/GIF/850583-75-4.gif) |
| | 3,6-Di(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione Chemical Properties |
| Boiling point | 691.9±55.0 °C(Predicted) | | density | 1.60±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 8.13±0.60(Predicted) | | color | Dark green to Dark red to Black | | InChI | InChI=1S/C14H8N2O2S2/c17-13-9-10(12(16-13)8-4-2-6-20-8)14(18)15-11(9)7-3-1-5-19-7/h1-6H,(H,15,18)(H,16,17) | | InChIKey | YIUHGBNJJRTMIE-UHFFFAOYSA-N | | SMILES | N1C(C2SC=CC=2)=C2C(=O)NC(C3SC=CC=3)=C2C1=O |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3,6-Di(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione Usage And Synthesis |
| Uses | suzuki reaction | | Uses | Used in the synthesis of donor-acceptor polymers which are used in polymer field-effect transistors and bulk heterojunction solar cells. | | General Description | 2,5-Dihydro-3,6-di-2-thienyl-pyrrolo[3,4-c]pyrrole-1,4-dione is a diketopyrrolopyrrole (DPP) based copolymer and are used widely in thin-film transistors and solar cell devices. This aromatic polymer has electron withdrawing groups and hence is very useful for the synthesis of narrow band gap donor-acceptor polymers which are used as active semiconductors for organic electronics. They give rise to high power conversion efficiency (PCE) in Organic Photovoltaic (OPV) Cells. |
| | 3,6-Di(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione Preparation Products And Raw materials |
|