|
|
| | 2-Amino-9,9-diphenylfluorene Basic information |
| Product Name: | 2-Amino-9,9-diphenylfluorene | | Synonyms: | 2-Amino-9,9-diphenylfluorene;2-AMino-9,9-diphenyl-9H-fluorene;2-AMino-9,9-diphenylfluorene ,9,9-Diphenyl-9H-fluoren-2-aMine;2-aMino-9,9-diphenylfluoren;DPF-NH2;2-Amino-9,9-iphenylfluorene;2-Amine-9,9'-diphenyl fluorene;9H-Fluoren-2-amine, 9,9-diphenyl- | | CAS: | 1268519-74-9 | | MF: | C25H19N | | MW: | 333.43 | | EINECS: | 808-037-1 | | Product Categories: | OLED materials,pharm chemical,electronic;OLED;fine chemicals, specialty chemicals, intermediates, electronic chemical, organic synthesis | | Mol File: | 1268519-74-9.mol |  |
| | 2-Amino-9,9-diphenylfluorene Chemical Properties |
| Boiling point | 496.6±24.0 °C(Predicted) | | density | 1.201 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder to crystal | | pka | 4.16±0.40(Predicted) | | color | White to Yellow | | InChI | InChI=1S/C25H19N/c26-20-15-16-22-21-13-7-8-14-23(21)25(24(22)17-20,18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-17H,26H2 | | InChIKey | MQRGCMXCVJPWHI-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)(C2=CC=CC=C2)C2=C(C=CC=C2)C2=C1C=C(N)C=C2 |
| | 2-Amino-9,9-diphenylfluorene Usage And Synthesis |
| Uses | 9,9-diphenyl-2-aminofluorene is an organic fluorene compound, which can be used as a pharmaceutical intermediate and an important intermediate in the synthesis of optoelectronic materials. |
| | 2-Amino-9,9-diphenylfluorene Preparation Products And Raw materials |
|