- BCPO
-
-
2026-05-19
- CAS:
- Min. Order: 1g
- Purity: 99.5%
- Supply Ability: 100KGS
|
| | Bis-4-(N-carbazolyl)phenyl)phenylphosphine oxide Basic information |
| Product Name: | Bis-4-(N-carbazolyl)phenyl)phenylphosphine oxide | | Synonyms: | Bis-4-(N-carbazolyl)phenyl)phenylphosphine oxide;9,9′-(4,4′-(Phenylphosphoryl)bis-(4,1-phenylene))bis(9H-carbazole);4,4'-Bis(N-carbazolyl)triphenylphosphine oxide;Bis[4-(9'-carbazolyl)phenyl]phenylphosphine oxide;9H-Carbazole, 9,9'-[(phenylphosphinylidene)di-4,1-phenylene]bis-;9,9'-((Phenylphosphinediyl)bis(4,1-phenylene))bis(9H-carbazole);Bis-4-(N-carbazolyl)phenyl)phenylphosphine oxide7;Bis(4-(9H-carbazol-9-yl)phenyl)(phenyl)phosphine oxide | | CAS: | 1233407-28-7 | | MF: | C42H29N2OP | | MW: | 608.67 | | EINECS: | | | Product Categories: | | | Mol File: | 1233407-28-7.mol |  |
| | Bis-4-(N-carbazolyl)phenyl)phenylphosphine oxide Chemical Properties |
| form | crystals/powder | | color | White | | InChIKey | BRTJBNHSYGCSQI-UHFFFAOYSA-N | | SMILES | P(C1=CC=C(N2C3=C(C=CC=C3)C3=C2C=CC=C3)C=C1)(C1=CC=C(N2C3=C(C=CC=C3)C3=C2C=CC=C3)C=C1)C1=CC=CC=C1 | | Melting point | Tg= 137 °C | | Absorption | λmax292 nm in DCM |
| | Bis-4-(N-carbazolyl)phenyl)phenylphosphine oxide Usage And Synthesis |
| Description | Bis-4-(N-carbazolyl)phenyl)phenylphosphine oxide as a BCPO molecule, were doped in PVK with certain concentrations, forming PVK:BCPO mixing light-emitting layers. It was used as the emitting material in Near ultraviolet organic light-emitting diodes (NUV-OLEDs) .[1] | | References | [1] YAN S, QIN M, SHEN C, et al. Efficient near ultraviolet organic light-emitting diode based on PVK material doped with BCPO molecules[J]. Synthetic Metals, 2020, 263: 116368. DOI:10.1016/j.synthmet.2020.116368. |
| | Bis-4-(N-carbazolyl)phenyl)phenylphosphine oxide Preparation Products And Raw materials |
|