- 1,4-dimethyltriazole
-
- $1.00
-
2020-01-13
- CAS:60166-43-0
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 1ton
- 1,4-dimethyltriazole
-
- $1.00
-
2020-01-10
- CAS:60166-43-0
- Min. Order: 1g
- Purity: 95--99%
- Supply Ability: 1ton
|
| | 1,4-diMethyl-1H-1,2,3-triazole Basic information |
| Product Name: | 1,4-diMethyl-1H-1,2,3-triazole | | Synonyms: | 1,4-diMethyl-1H-1,2,3-triazole;EOS-61404;1H-1,2,3-Triazole, 1,4-dimethyl-;1,4-dimethyltriazole | | CAS: | 60166-43-0 | | MF: | C4H7N3 | | MW: | 97.12 | | EINECS: | 200-258-5 | | Product Categories: | | | Mol File: | 60166-43-0.mol |  |
| | 1,4-diMethyl-1H-1,2,3-triazole Chemical Properties |
| Melting point | 315 °C (decomp) | | Boiling point | 173.7±33.0 °C(Predicted) | | density | 1.12±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 1.79±0.10(Predicted) | | Appearance | Off-white to light yellow Solid-liquid mixture | | InChI | InChI=1S/C4H7N3/c1-4-3-7(2)6-5-4/h3H,1-2H3 | | InChIKey | OJAWOLWHEQUTDE-UHFFFAOYSA-N | | SMILES | N1(C)C=C(C)N=N1 |
| | 1,4-diMethyl-1H-1,2,3-triazole Usage And Synthesis |
| | 1,4-diMethyl-1H-1,2,3-triazole Preparation Products And Raw materials |
|